The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(2,3-Dihydro-3-methyl-2-oxo-1H-imidazo[4,5-b]pyridin-7-yl-oxy)phenyl)-3-(4-chloro-3-(trifluoromethyl)phenyl)urea ID: ALA523129
Cas Number: 884339-66-6
PubChem CID: 11719900
Max Phase: Preclinical
Molecular Formula: C21H15ClF3N5O3
Molecular Weight: 477.83
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cn1c(=O)[nH]c2c(Oc3ccc(NC(=O)Nc4ccc(Cl)c(C(F)(F)F)c4)cc3)ccnc21
Standard InChI: InChI=1S/C21H15ClF3N5O3/c1-30-18-17(29-20(30)32)16(8-9-26-18)33-13-5-2-11(3-6-13)27-19(31)28-12-4-7-15(22)14(10-12)21(23,24)25/h2-10H,1H3,(H,29,32)(H2,27,28,31)
Standard InChI Key: MNCDHOPLKWNXCF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
10.7280 -24.3153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7268 -25.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4423 -25.5565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4405 -23.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1563 -24.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1612 -25.1434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9538 -25.3958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4388 -24.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9459 -24.0501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2644 -24.7151 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4380 -23.0765 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7230 -22.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7310 -21.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0191 -21.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3008 -21.8173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2986 -22.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0110 -23.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5876 -21.4013 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5913 -20.5756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8781 -20.1596 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.3082 -20.1660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1610 -20.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4517 -20.1483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7350 -20.5568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7361 -21.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4481 -21.7998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1618 -21.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2135 -26.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0195 -21.7899 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.4437 -22.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4385 -23.4480 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.2693 -22.6302 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.6180 -22.6237 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
6 7 1 0
16 17 2 0
17 12 1 0
7 8 1 0
15 18 1 0
8 9 1 0
18 19 1 0
9 5 1 0
19 20 1 0
4 1 1 0
19 21 2 0
8 10 2 0
20 22 1 0
5 6 1 0
22 23 2 0
4 11 1 0
23 24 1 0
24 25 2 0
11 12 1 0
25 26 1 0
2 3 1 0
26 27 2 0
27 22 1 0
12 13 2 0
7 28 1 0
3 6 2 0
25 29 1 0
13 14 1 0
26 30 1 0
1 2 2 0
30 31 1 0
14 15 2 0
30 32 1 0
5 4 2 0
30 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.83Molecular Weight (Monoisotopic): 477.0816AlogP: 5.37#Rotatable Bonds: 4Polar Surface Area: 101.04Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.49CX Basic pKa: 2.77CX LogP: 4.69CX LogD: 4.69Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.43
References 1. Niculescu-Duvaz D, Gaulon C, Dijkstra HP, Niculescu-Duvaz I, Zambon A, Ménard D, Suijkerbuijk BM, Nourry A, Davies L, Manne H, Friedlos F, Ogilvie L, Hedley D, Whittaker S, Kirk R, Gill A, Taylor RD, Raynaud FI, Moreno-Farre J, Marais R, Springer CJ.. (2009) Pyridoimidazolones as novel potent inhibitors of v-Raf murine sarcoma viral oncogene homologue B1 (BRAF)., 52 (8): [PMID:19323560 ] [10.1021/jm801509w ]