(3S,4R)-6-Chloro-2-[6-(4-chloro-benzenesulfonyl)-3-hydroxy-2,2-dimethyl-chroman-4-yl]-benzo[d]isoxazol-3-one

ID: ALA523142

PubChem CID: 44564465

Max Phase: Preclinical

Molecular Formula: C24H19Cl2NO6S

Molecular Weight: 520.39

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)Oc2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2[C@@H](n2oc3cc(Cl)ccc3c2=O)[C@@H]1O

Standard InChI:  InChI=1S/C24H19Cl2NO6S/c1-24(2)22(28)21(27-23(29)17-9-5-14(26)11-20(17)33-27)18-12-16(8-10-19(18)32-24)34(30,31)15-6-3-13(25)4-7-15/h3-12,21-22,28H,1-2H3/t21-,22+/m1/s1

Standard InChI Key:  OXOGFODEQCWLLO-YADHBBJMSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -1.4471   -2.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4482   -3.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7335   -4.1270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7353   -2.4743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0200   -2.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0212   -3.7163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6956   -4.1315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4181   -3.7184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4193   -2.8854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6980   -2.4656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8247   -4.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1289   -3.2995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1347   -2.4747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6980   -1.6407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3637   -1.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0291   -1.1579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1481   -1.4133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2840   -0.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1084   -0.3767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5218    0.3345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1117    1.0496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2840    1.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1256    0.3370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1614   -2.4747    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8787   -2.0622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7497   -1.7600    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5711   -3.1907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8772   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5936   -0.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3105   -1.2361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3065   -2.0678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5895   -2.4765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0261   -0.8258    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.1293    1.7629    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 18 16  1  0
 16 14  1  0
  4  1  1  0
 15 17  2  0
  5 10  1  0
  6  7  1  0
 18 19  2  0
  7  8  1  0
 19 20  1  0
  8  9  1  0
 20 21  2  0
  9 10  1  0
 21 22  1  0
  5  6  1  0
 22 23  2  0
 23 18  1  0
  8 11  1  0
  1 24  1  0
 24 25  1  0
  8 12  1  0
 24 26  2  0
  2  3  1  0
 24 27  2  0
  9 13  1  6
  3  6  2  0
 25 28  2  0
 10 14  1  1
 28 29  1  0
 14 15  1  0
 29 30  2  0
  1  2  2  0
 30 31  1  0
  5  4  2  0
 31 32  2  0
 32 25  1  0
 15 19  1  0
 30 33  1  0
 22 34  1  0
M  END

Associated Targets(Human)

ABCC9 Tclin Sulfonylurea receptor 2 (109 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.39Molecular Weight (Monoisotopic): 519.0310AlogP: 4.86#Rotatable Bonds: 3
Polar Surface Area: 98.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.16CX Basic pKa: CX LogP: 4.79CX LogD: 4.79
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.17

References

1. Zhang X, Qiu Y, Li X, Bhattacharjee S, Woods M, Kraft P, Lundeen SG, Sui Z..  (2009)  Discovery and structure-activity relationships of a novel series of benzopyran-based K(ATP) openers for urge urinary incontinence.,  17  (2): [PMID:19101153] [10.1016/j.bmc.2008.11.055]

Source