The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.
Benzyloxycarbonyl-KKR-H ID: ALA523197
PubChem CID: 24971352
Max Phase: Preclinical
Molecular Formula: C26H44N8O5
Molecular Weight: 548.69
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Benzyloxycarbonyl-Kkr-H | Benzyloxycarbonyl-KKR-H|CHEMBL523197|BDBM24736|Capped tripeptide aldehyde inhibitor, 24|benzyl N-[(1S)-5-amino-1-{[(1S)-5-amino-1-{[(2S)-5-carbamimidamido-1-oxopentan-2-yl]carbamoyl}pentyl]carbamoyl}pentyl]carbamate
Canonical SMILES: N=C(N)NCCC[C@@H](C=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)OCc1ccccc1
Standard InChI: InChI=1S/C26H44N8O5/c27-14-6-4-12-21(23(36)32-20(17-35)11-8-16-31-25(29)30)33-24(37)22(13-5-7-15-28)34-26(38)39-18-19-9-2-1-3-10-19/h1-3,9-10,17,20-22H,4-8,11-16,18,27-28H2,(H,32,36)(H,33,37)(H,34,38)(H4,29,30,31)/t20-,21-,22-/m0/s1
Standard InChI Key: FRGIPEISBWOFTB-FKBYEOEOSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
15.1790 -25.5283 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.8949 -25.1116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6149 -26.3533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.6149 -25.5283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8949 -24.2866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6149 -23.8700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6149 -23.0450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3308 -22.6283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0379 -25.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7538 -24.2815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.7538 -25.1065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0379 -26.3482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7538 -26.7649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7538 -27.5899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4738 -28.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.6053 -21.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1808 -25.1047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8966 -26.3464 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.8966 -25.5214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1808 -24.2797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8966 -23.8631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8966 -23.0381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4631 -25.1183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7501 -25.5333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.4602 -24.2933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.0341 -25.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3264 -25.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6116 -25.1333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9043 -25.5504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9117 -26.3730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6323 -26.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3367 -26.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3248 -21.7999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.3249 -25.1081 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4678 -28.8280 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.6110 -22.6255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.8923 -21.3822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.3282 -21.3822 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.4678 -25.5197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14 15 1 0
17 19 1 0
19 18 2 0
17 20 1 1
20 21 1 0
21 22 1 0
1 23 1 0
23 24 1 0
23 25 2 0
1 2 1 0
24 26 1 0
2 4 1 0
27 26 1 0
4 3 2 0
27 28 2 0
2 5 1 1
28 29 1 0
5 6 1 0
29 30 2 0
6 7 1 0
30 31 1 0
7 8 1 0
31 32 2 0
32 27 1 0
9 11 1 0
11 10 2 0
9 12 1 6
12 13 1 0
13 14 1 0
36 16 1 0
22 36 1 0
4 34 1 0
34 9 1 0
16 37 1 0
8 33 1 0
16 38 2 0
15 35 1 0
39 17 1 0
11 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Calculated Properties Molecular Weight: 548.69Molecular Weight (Monoisotopic): 548.3435AlogP: -0.03#Rotatable Bonds: 20Polar Surface Area: 227.54Molecular Species: BASEHBA: 8HBD: 8#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 11#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.33CX Basic pKa: 11.90CX LogP: -1.22CX LogD: -8.31Aromatic Rings: 1Heavy Atoms: 39QED Weighted: 0.05Np Likeness Score: 0.36
References 1. Stoermer MJ, Chappell KJ, Liebscher S, Jensen CM, Gan CH, Gupta PK, Xu WJ, Young PR, Fairlie DP.. (2008) Potent cationic inhibitors of West Nile virus NS2B/NS3 protease with serum stability, cell permeability and antiviral activity., 51 (18): [PMID:18729351 ] [10.1021/jm800503y ]