(R)-2-(9-(1H-1,2,3-Triazol-1-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol

ID: ALA523260

PubChem CID: 25119043

Max Phase: Preclinical

Molecular Formula: C24H37N3O2

Molecular Weight: 399.58

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCCCCCCCn1ccnn1)O2

Standard InChI:  InChI=1S/C24H37N3O2/c1-18-19(2)23-21(20(3)22(18)28)12-14-24(4,29-23)13-10-8-6-5-7-9-11-16-27-17-15-25-26-27/h15,17,28H,5-14,16H2,1-4H3/t24-/m1/s1

Standard InChI Key:  HQIQCTAFFFMLKO-XMMPIXPASA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   -0.0546   -6.4129    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6574   -6.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6574   -5.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0546   -4.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7667   -6.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7641   -5.1813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4747   -4.7693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1882   -5.1793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1868   -6.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4757   -6.4140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9005   -6.4197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4747   -7.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4730   -3.9443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9027   -4.7667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0626   -6.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3668   -5.5879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0843   -5.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7958   -5.5771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5133   -5.9842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2248   -5.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9423   -5.9735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6538   -5.5556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3713   -5.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0828   -5.5448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -5.9520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8894   -6.7677    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6977   -6.9331    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1049   -6.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5482   -5.6067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  8 14  1  0
  6  7  1  0
  2 15  1  6
  1  2  1  0
  2 16  1  0
  7  8  2  0
 16 17  1  0
  2  3  1  0
 17 18  1  0
  8  9  1  0
 18 19  1  0
  3  4  1  0
 19 20  1  0
  9 10  2  0
 20 21  1  0
 10  5  1  0
 21 22  1  0
 22 23  1  0
  9 11  1  0
 23 24  1  0
  6  4  1  0
 24 25  1  0
 25 26  1  0
 10 12  1  0
  5  6  2  0
  7 13  1  0
  5  1  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 25  1  0
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CYP3A4 Tclin Cytochrome P450 3A4 (53859 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 399.58Molecular Weight (Monoisotopic): 399.2886AlogP: 5.81#Rotatable Bonds: 10
Polar Surface Area: 60.17Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.80CX Basic pKa: 0.70CX LogP: 6.97CX LogD: 6.97
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.51Np Likeness Score: 0.53

References

1. Ohnmacht S, Nava P, West R, Parker R, Atkinson J..  (2008)  Inhibition of oxidative metabolism of tocopherols with omega-N-heterocyclic derivatives of vitamin E.,  16  (16): [PMID:18656365] [10.1016/j.bmc.2008.07.020]

Source