The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
benzyl 2-amino-3-(3,4,5-trimethoxybenzoyl)-4,5-dihydrothieno[2,3-c]pyridine-6(7H)-carboxylate ID: ALA523396
PubChem CID: 44580425
Max Phase: Preclinical
Molecular Formula: C25H26N2O6S
Molecular Weight: 482.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)c2c(N)sc3c2CCN(C(=O)OCc2ccccc2)C3)cc(OC)c1OC
Standard InChI: InChI=1S/C25H26N2O6S/c1-30-18-11-16(12-19(31-2)23(18)32-3)22(28)21-17-9-10-27(13-20(17)34-24(21)26)25(29)33-14-15-7-5-4-6-8-15/h4-8,11-12H,9-10,13-14,26H2,1-3H3
Standard InChI Key: MWLYDGLECFVMIT-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.7896 -17.9970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9623 -18.0052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5574 -18.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9789 -19.4365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8093 -19.4243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2104 -18.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1939 -17.2778 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5422 -17.2950 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7324 -18.7337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3120 -18.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7173 -17.3036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0189 -17.2683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2325 -20.1325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8308 -20.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0575 -20.1200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5736 -22.1620 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.1782 -21.6008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8528 -21.7603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0144 -20.9490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3959 -20.4064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6124 -20.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4509 -21.4813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0729 -22.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9878 -21.7597 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.6693 -21.7456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0496 -21.2010 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5074 -22.5547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2115 -20.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5930 -19.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7536 -19.0382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1337 -18.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3530 -18.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1956 -19.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8168 -20.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18 16 1 0
16 17 1 0
17 14 2 0
18 19 2 0
3 9 1 0
4 5 1 0
9 10 1 0
2 3 1 0
8 11 1 0
18 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
5 6 2 0
17 24 1 0
7 12 1 0
22 25 1 0
6 1 1 0
25 26 1 0
5 13 1 0
25 27 2 0
1 2 2 0
26 28 1 0
28 29 1 0
13 14 1 0
1 7 1 0
29 30 2 0
13 15 2 0
30 31 1 0
14 19 1 0
31 32 2 0
3 4 2 0
32 33 1 0
2 8 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 482.56Molecular Weight (Monoisotopic): 482.1512AlogP: 4.28#Rotatable Bonds: 7Polar Surface Area: 100.32Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.41CX LogD: 4.41Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: -0.76
References 1. Romagnoli R, Baraldi PG, Carrion MD, Cruz-Lopez O, Cara CL, Tolomeo M, Grimaudo S, Di Cristina A, Pipitone MR, Balzarini J, Kandil S, Brancale A, Sarkar T, Hamel E.. (2008) Synthesis and biological evaluation of 2-amino-3-(3',4',5'-trimethoxybenzoyl)-6-substituted-4,5,6,7-tetrahydrothieno[2,3-c]pyridine derivatives as antimitotic agents and inhibitors of tubulin polymerization., 18 (18): [PMID:18725179 ] [10.1016/j.bmcl.2008.08.006 ]