The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3,6-Bis(N,N-dimethylamino)-9-(2-N,N-diethylcarboxamidophenyl)thioxanthylium Hexafluorophosphate ID: ALA524023
PubChem CID: 44139213
Max Phase: Preclinical
Molecular Formula: C28H32F6N3OPS
Molecular Weight: 458.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)C(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2sc2cc(N(C)C)ccc12.F[P-](F)(F)(F)(F)F
Standard InChI: InChI=1S/C28H32N3OS.F6P/c1-7-31(8-2)28(32)22-12-10-9-11-21(22)27-23-15-13-19(29(3)4)17-25(23)33-26-18-20(30(5)6)14-16-24(26)27;1-7(2,3,4,5)6/h9-18H,7-8H2,1-6H3;/q+1;-1
Standard InChI Key: ABELUKOJMATOKF-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 42 0 0 0 0 0 0 0 0999 V2000
20.4612 -21.5407 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
19.7403 -21.9438 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.4497 -22.3654 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.1711 -21.9644 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.1828 -21.1420 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.4777 -20.7198 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
19.7564 -21.1207 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
15.7313 -23.2975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7302 -24.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4441 -24.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4423 -22.8853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1567 -23.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1601 -24.1258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8783 -24.5366 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
17.8714 -22.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5942 -23.2880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5971 -24.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3213 -24.5374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0431 -24.1163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0361 -23.2773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3114 -22.8675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7592 -24.5237 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7644 -25.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4700 -24.1072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0164 -24.5351 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3032 -24.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0157 -25.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8669 -22.0488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5785 -21.6397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8620 -20.4076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1490 -20.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5760 -20.8194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1499 -21.6487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3236 -21.6414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9048 -22.3536 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.9178 -20.9245 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3357 -20.2144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0939 -20.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6880 -20.2006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9298 -19.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
1 6 1 0
1 5 1 0
1 7 1 0
1 3 1 0
1 4 1 0
14 17 1 0
25 26 1 0
16 15 2 0
25 27 1 0
15 28 1 0
28 29 2 0
12 11 2 0
30 31 1 0
16 17 1 0
11 8 1 0
17 18 2 0
12 13 1 0
28 33 1 0
29 32 1 0
32 30 2 0
31 33 2 0
18 19 1 0
33 34 1 0
8 9 2 0
34 35 2 0
19 20 1 0
34 36 1 0
36 37 1 0
20 21 2 0
36 38 1 0
21 16 1 0
38 39 1 0
9 10 1 0
37 40 1 0
19 22 2 0
10 13 2 0
22 23 1 0
12 15 1 0
22 24 1 0
13 14 1 0
9 25 1 0
M CHG 2 1 -1 22 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.65Molecular Weight (Monoisotopic): 458.2261AlogP: 5.25#Rotatable Bonds: 5Polar Surface Area: 26.56Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.38CX LogP: 0.97CX LogD: 0.97Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -0.94
References 1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR.. (2009) Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity., 52 (10): [PMID:19402665 ] [10.1021/jm900253g ]