3,6-Bis(N,N-dimethylamino)-9-(2-N,N-diethylcarboxamidophenyl)thioxanthylium Hexafluorophosphate

ID: ALA524023

PubChem CID: 44139213

Max Phase: Preclinical

Molecular Formula: C28H32F6N3OPS

Molecular Weight: 458.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN(CC)C(=O)c1ccccc1-c1c2ccc(=[N+](C)C)cc-2sc2cc(N(C)C)ccc12.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C28H32N3OS.F6P/c1-7-31(8-2)28(32)22-12-10-9-11-21(22)27-23-15-13-19(29(3)4)17-25(23)33-26-18-20(30(5)6)14-16-24(26)27;1-7(2,3,4,5)6/h9-18H,7-8H2,1-6H3;/q+1;-1

Standard InChI Key:  ABELUKOJMATOKF-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 40 42  0  0  0  0  0  0  0  0999 V2000
   20.4612  -21.5407    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   19.7403  -21.9438    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.4497  -22.3654    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.1711  -21.9644    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.1828  -21.1420    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.4777  -20.7198    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.7564  -21.1207    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   15.7313  -23.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7302  -24.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4441  -24.5361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4423  -22.8853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1567  -23.2939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1601  -24.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8783  -24.5366    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.8714  -22.8726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5942  -23.2880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5971  -24.1237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3213  -24.5374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0431  -24.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0361  -23.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3114  -22.8675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7592  -24.5237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7644  -25.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4700  -24.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0164  -24.5351    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.3032  -24.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0157  -25.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8669  -22.0488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5785  -21.6397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8620  -20.4076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1490  -20.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5760  -20.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1499  -21.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3236  -21.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9048  -22.3536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.9178  -20.9245    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3357  -20.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0939  -20.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6880  -20.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9298  -19.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 14 17  1  0
 25 26  1  0
 16 15  2  0
 25 27  1  0
 15 28  1  0
 28 29  2  0
 12 11  2  0
 30 31  1  0
 16 17  1  0
 11  8  1  0
 17 18  2  0
 12 13  1  0
 28 33  1  0
 29 32  1  0
 32 30  2  0
 31 33  2  0
 18 19  1  0
 33 34  1  0
  8  9  2  0
 34 35  2  0
 19 20  1  0
 34 36  1  0
 36 37  1  0
 20 21  2  0
 36 38  1  0
 21 16  1  0
 38 39  1  0
  9 10  1  0
 37 40  1  0
 19 22  2  0
 10 13  2  0
 22 23  1  0
 12 15  1  0
 22 24  1  0
 13 14  1  0
  9 25  1  0
M  CHG  2   1  -1  22   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.65Molecular Weight (Monoisotopic): 458.2261AlogP: 5.25#Rotatable Bonds: 5
Polar Surface Area: 26.56Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.38CX LogP: 0.97CX LogD: 0.97
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.30Np Likeness Score: -0.94

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source