3-Oxo-Olean-12-en-29-oic acid ethyl ester

ID: ALA524034

PubChem CID: 10719609

Max Phase: Preclinical

Molecular Formula: C32H50O3

Molecular Weight: 482.75

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1

Standard InChI:  InChI=1S/C32H50O3/c1-9-35-26(34)29(5)17-16-28(4)18-19-31(7)21(22(28)20-29)10-11-24-30(6)14-13-25(33)27(2,3)23(30)12-15-32(24,31)8/h10,22-24H,9,11-20H2,1-8H3/t22-,23-,24+,28+,29+,30-,31+,32+/m0/s1

Standard InChI Key:  KXJBITWTAJKRFJ-PYTCHGMCSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    8.4357   -6.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4357   -7.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1501   -8.1390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1501   -6.4836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8645   -6.9016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8610   -7.7293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5720   -8.1439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2911   -7.7353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5790   -6.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2908   -6.9102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3078   -5.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5844   -5.6635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0195   -5.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0055   -6.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7082   -6.9259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4293   -6.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7360   -5.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4388   -5.7064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1571   -5.3140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1789   -4.4919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4761   -4.0636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7516   -4.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1502   -6.1199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0141   -4.8616    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0549   -3.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8826   -3.3442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2825   -6.0823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8570   -6.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7196   -8.1442    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7284   -8.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8528   -8.5528    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5719   -7.3155    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.9973   -7.3280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7076   -3.3344    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4616   -2.6303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.5561   -8.8538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1300   -4.0463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9576   -4.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 14 15  1  0
 26 34  1  0
 26 35  2  0
 15 16  1  0
  3 36  1  0
 16 18  1  0
 34 37  1  0
 17 18  1  0
 37 38  1  0
M  END

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 482.75Molecular Weight (Monoisotopic): 482.3760AlogP: 7.92#Rotatable Bonds: 2
Polar Surface Area: 43.37Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 7.66CX LogD: 7.66
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: 2.86

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source