3,6-Bis(N,N-dimethylamino)-9-(2-thienyl-5-carboxamido)-thioxanthylium Hexafluorophosphate

ID: ALA524129

PubChem CID: 44139099

Max Phase: Preclinical

Molecular Formula: C22H22F6N3OPS2

Molecular Weight: 408.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN(C)c1ccc2c(-c3ccc(C(N)=O)s3)c3ccc(=[N+](C)C)cc-3sc2c1.F[P-](F)(F)(F)(F)F

Standard InChI:  InChI=1S/C22H21N3OS2.F6P/c1-24(2)13-5-7-15-19(11-13)28-20-12-14(25(3)4)6-8-16(20)21(15)17-9-10-18(27-17)22(23)26;1-7(2,3,4,5)6/h5-12H,1-4H3,(H-,23,26);/q;-1/p+1

Standard InChI Key:  PMSRSYWOCDBLMO-UHFFFAOYSA-O

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
    2.3519  -15.2160    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    1.6311  -15.6190    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.3404  -16.0405    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0615  -15.6395    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0733  -14.8173    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.3682  -14.3953    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6471  -14.7961    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6221  -17.7835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6233  -18.6095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9097  -19.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9115  -17.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1972  -17.7798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1939  -18.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4758  -19.0222    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4826  -17.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2400  -17.7739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2429  -18.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9668  -19.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6883  -18.6021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6814  -17.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9568  -17.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4872  -16.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4043  -19.0093    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4096  -19.8330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1149  -18.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3370  -19.0208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0499  -18.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3376  -19.8445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1708  -16.0464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0881  -15.2645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9117  -15.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1618  -16.0538    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3996  -14.6054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0685  -13.8541    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2180  -14.6991    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  1  6  1  0
  1  5  1  0
  1  7  1  0
  1  3  1  0
  1  4  1  0
 19 23  2  0
 12 15  1  0
 23 24  1  0
 13 14  1  0
 23 25  1  0
 14 17  1  0
  9 26  1  0
 16 15  2  0
 26 27  1  0
 26 28  1  0
 22 29  2  0
 12 11  2  0
 16 17  1  0
 11  8  1  0
 17 18  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 22  1  0
 12 13  1  0
 31 33  1  0
 18 19  1  0
  8  9  2  0
 33 34  1  0
 33 35  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
  9 10  1  0
 15 22  1  0
 10 13  2  0
M  CHG  2   1  -1  23   1
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 408.57Molecular Weight (Monoisotopic): 408.1199AlogP: 3.93#Rotatable Bonds: 3
Polar Surface Area: 49.34Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.55CX Basic pKa: 3.29CX LogP: -0.14CX LogD: -0.14
Aromatic Rings: 2Heavy Atoms: 28QED Weighted: 0.41Np Likeness Score: -0.67

References

1. Gannon MK, Holt JJ, Bennett SM, Wetzel BR, Loo TW, Bartlett MC, Clarke DM, Sawada GA, Higgins JW, Tombline G, Raub TJ, Detty MR..  (2009)  Rhodamine inhibitors of P-glycoprotein: an amide/thioamide "switch" for ATPase activity.,  52  (10): [PMID:19402665] [10.1021/jm900253g]

Source