3-methyloximo-olean-12-en-29-oic acid

ID: ALA524160

PubChem CID: 44566379

Max Phase: Preclinical

Molecular Formula: C31H49NO3

Molecular Weight: 483.74

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO/N=C1/CC[C@]2(C)[C@H]3CC=C4[C@@H]5C[C@](C)(C(=O)O)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C1(C)C

Standard InChI:  InChI=1S/C31H49NO3/c1-26(2)22-11-14-31(7)23(29(22,5)13-12-24(26)32-35-8)10-9-20-21-19-28(4,25(33)34)16-15-27(21,3)17-18-30(20,31)6/h9,21-23H,10-19H2,1-8H3,(H,33,34)/b32-24-/t21-,22-,23+,27+,28+,29-,30+,31+/m0/s1

Standard InChI Key:  SAJCKHUHILYREB-VMJQRFLMSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    6.5655  -20.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5655  -21.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2800  -22.2137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2800  -20.5577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9946  -20.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9911  -21.8039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7025  -22.2186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4219  -21.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7095  -20.5626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4215  -20.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4385  -19.3324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7148  -19.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1504  -19.7542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1366  -20.5784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8394  -21.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5607  -20.6024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8672  -19.3517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5704  -19.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2889  -19.3877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3107  -18.5653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6076  -18.1368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8828  -18.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2819  -20.1939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1450  -18.9352    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1863  -17.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0143  -17.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4133  -20.1562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9872  -20.1479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8490  -22.2189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8581  -22.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9831  -22.6277    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7023  -21.3899    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.1284  -21.4025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5932  -16.7029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6861  -22.9288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8423  -17.4096    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8502  -23.0469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1337  -23.4620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  7  1  0
  7  8  1  0
  8 10  1  0
  9 10  1  0
  3  6  1  0
  5  4  1  0
 17 22  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
  5  6  1  0
 18 23  1  1
 17 24  1  1
  9 12  1  0
 21 25  1  1
 10 14  1  0
 21 26  1  0
 13 11  2  0
 10 27  1  1
 11 12  1  0
  5 28  1  1
 13 14  1  0
  2 29  2  0
  1  2  1  0
  3 30  1  0
  1  4  1  0
  6 31  1  6
  2  3  1  0
  9 32  1  6
  5  9  1  0
 14 33  1  6
 13 17  1  0
 26 34  2  0
 14 15  1  0
  3 35  1  0
 15 16  1  0
 26 36  1  0
 16 18  1  0
 29 37  1  0
 17 18  1  0
 37 38  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Polb DNA polymerase beta (216 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.74Molecular Weight (Monoisotopic): 483.3712AlogP: 7.88#Rotatable Bonds: 2
Polar Surface Area: 58.89Molecular Species: ACIDHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.64CX Basic pKa: 3.41CX LogP: 7.35CX LogD: 4.83
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: 2.91

References

1. Sun DA, Starck SR, Locke EP, Hecht SM..  (1999)  DNA polymerase beta inhibitors from Sandoricum koetjape.,  62  (8): [PMID:10479314] [10.1021/np990104r]

Source