Oteromycin

ID: ALA524269

PubChem CID: 44583725

Max Phase: Preclinical

Molecular Formula: C32H41NO3

Molecular Weight: 487.68

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Synonyms: Oteromycin | Oteromycin|CHEMBL524269|BDBM50269176

Canonical SMILES:  C/C=C(C)/C=C(\C)[C@H]1C(C)=C[C@@]2(C)C[C@@H](C)CC[C@@H]2[C@H]1C(=O)C1=CC(O)(Cc2ccccc2)NC1=O

Standard InChI:  InChI=1S/C32H41NO3/c1-7-20(2)15-22(4)27-23(5)17-31(6)16-21(3)13-14-26(31)28(27)29(34)25-19-32(36,33-30(25)35)18-24-11-9-8-10-12-24/h7-12,15,17,19,21,26-28,36H,13-14,16,18H2,1-6H3,(H,33,35)/b20-7+,22-15+/t21-,26+,27-,28+,31+,32?/m0/s1

Standard InChI Key:  LERBUEGMFSDFOI-KISHBQHMSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    0.4564  -19.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676  -19.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6913  -19.7662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1032  -19.0521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676  -18.3413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6942  -18.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0998  -17.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6833  -16.9072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8593  -16.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4509  -17.6300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564  -20.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3702  -20.4758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676  -21.1895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564  -21.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676  -22.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3702  -21.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7814  -22.6209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1025  -20.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5208  -18.3308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0453  -18.3413    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0987  -16.1936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3701  -19.0526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7809  -18.3397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7817  -19.7669    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4469  -17.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0614  -17.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6046  -18.2519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1571  -18.8654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5478  -16.3636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3720  -16.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8029  -15.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6260  -15.7038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0216  -16.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5853  -17.1348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7607  -17.1103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7756  -17.4448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4501  -16.4815    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  6  1  0
  5  6  1  0
  5 10  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  2 11  1  6
 11 12  1  0
 11 13  2  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 16 17  1  0
  3 18  1  0
  6 19  1  1
  5 20  1  6
  8 21  1  6
  1 22  1  6
 22 23  1  0
 22 24  2  0
 23 25  2  0
 25 26  1  0
 27 23  1  0
 27 28  2  0
 26 29  1  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 30  1  0
  5  1  1  0
 26 36  1  0
 36 27  1  0
 26 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA524269

    OTEROMYCIN

Associated Targets(Human)

GPR37L1 Tbio Endothelin B receptor-like protein 2 (2 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.68Molecular Weight (Monoisotopic): 487.3086AlogP: 6.09#Rotatable Bonds: 6
Polar Surface Area: 66.40Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.89CX Basic pKa: CX LogP: 6.56CX LogD: 6.56
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: 2.05

References

1. Suzuki S, Hosoe T, Nozawa K, Kawai K, Yaguchi T, Udagawa S..  (2000)  Antifungal substances against pathogenic fungi, talaroconvolutins, from talaromyces convolutus.,  63  (6): [PMID:10869198] [10.1021/np990371x]

Source