N-[5-(3,4-Dichlorophenyl)pyridin-2-yl]benzamide

ID: ALA524289

PubChem CID: 24949712

Max Phase: Preclinical

Molecular Formula: C18H12Cl2N2O

Molecular Weight: 343.21

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2ccc(Cl)c(Cl)c2)cn1)c1ccccc1

Standard InChI:  InChI=1S/C18H12Cl2N2O/c19-15-8-6-13(10-16(15)20)14-7-9-17(21-11-14)22-18(23)12-4-2-1-3-5-12/h1-11H,(H,21,22,23)

Standard InChI Key:  LANNPOZEUWIROM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -1.0524   -6.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0536   -7.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3381   -7.8515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3790   -7.4377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3761   -6.6065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3399   -6.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0948   -7.8495    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8092   -7.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5250   -7.8473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5216   -8.6715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2365   -9.0831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9520   -8.6691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9481   -7.8390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2325   -7.4311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8079   -6.6098    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7655   -6.1976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7644   -5.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4787   -4.9581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1947   -5.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1919   -6.2012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4769   -6.6101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4785   -4.1323    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.9105   -4.9595    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  5  6  2  0
 11 12  2  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 13 14  2  0
 14  9  1  0
  4  7  1  0
  8 15  2  0
  3  4  2  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
  2  3  1  0
 18 22  1  0
 10 11  1  0
 19 23  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Luciferase (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 343.21Molecular Weight (Monoisotopic): 342.0327AlogP: 5.31#Rotatable Bonds: 3
Polar Surface Area: 41.99Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.24CX LogP: 5.30CX LogD: 5.30
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.70Np Likeness Score: -1.50

References

1. Heitman LH, van Veldhoven JP, Zweemer AM, Ye K, Brussee J, IJzerman AP..  (2008)  False positives in a reporter gene assay: identification and synthesis of substituted N-pyridin-2-ylbenzamides as competitive inhibitors of firefly luciferase.,  51  (15): [PMID:18646744] [10.1021/jm8004509]

Source