(R)-2-(9-(2H-benzo[d][1,2,3]triazol-2-yl)nonyl)-2,5,7,8-tetramethylchroman-6-ol

ID: ALA524615

PubChem CID: 25119391

Max Phase: Preclinical

Molecular Formula: C28H39N3O2

Molecular Weight: 449.64

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C)c2c(c(C)c1O)CC[C@@](C)(CCCCCCCCCn1nc3ccccc3n1)O2

Standard InChI:  InChI=1S/C28H39N3O2/c1-20-21(2)27-23(22(3)26(20)32)16-18-28(4,33-27)17-12-8-6-5-7-9-13-19-31-29-24-14-10-11-15-25(24)30-31/h10-11,14-15,32H,5-9,12-13,16-19H2,1-4H3/t28-/m1/s1

Standard InChI Key:  LPNXXNVIMVTNBS-MUUNZHRXSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -2.3591   -0.3083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6470    0.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6470    0.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3591    1.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0712    0.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0687    0.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7792    1.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4928    0.9253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4913    0.0988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7803   -0.3095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2051   -0.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7792   -1.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7776    2.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2073    1.3380    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2418   -0.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9376    0.5168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2199    0.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4915    0.5275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091    0.1203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9205    0.5383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6382    0.1311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3496    0.5491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0673    0.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7787    0.5598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4964    0.1526    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5854   -0.6632    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2442    0.4980    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8009   -0.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3910   -0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8049   -1.5359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6286   -1.5327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0367   -0.8133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6203   -0.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2 16  1  0
  7  8  2  0
 16 17  1  0
  2  3  1  0
 17 18  1  0
  8  9  1  0
 18 19  1  0
  3  4  1  0
 19 20  1  0
  9 10  2  0
 20 21  1  0
 10  5  1  0
 21 22  1  0
 22 23  1  0
  9 11  1  0
 23 24  1  0
  6  4  1  0
 24 25  1  0
 25 26  1  0
 10 12  1  0
  5  6  2  0
 26 29  2  0
 28 27  2  0
 27 25  1  0
  7 13  1  0
  5  1  1  0
 28 29  1  0
  8 14  1  0
 29 30  1  0
  6  7  1  0
 30 31  2  0
  2 15  1  6
 31 32  1  0
  1  2  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(Human)

CYP4F2 Tchem Cytochrome P450 4F2 (83 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 449.64Molecular Weight (Monoisotopic): 449.3042AlogP: 6.97#Rotatable Bonds: 10
Polar Surface Area: 60.17Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.80CX Basic pKa: CX LogP: 8.44CX LogD: 8.44
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: 0.65

References

1. Ohnmacht S, Nava P, West R, Parker R, Atkinson J..  (2008)  Inhibition of oxidative metabolism of tocopherols with omega-N-heterocyclic derivatives of vitamin E.,  16  (16): [PMID:18656365] [10.1016/j.bmc.2008.07.020]

Source