N-[5-(4-Isopropoxy-phenyl)pyridin-2-yl]benzamide

ID: ALA526295

PubChem CID: 24949406

Max Phase: Preclinical

Molecular Formula: C21H20N2O2

Molecular Weight: 332.40

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)Oc1ccc(-c2ccc(NC(=O)c3ccccc3)nc2)cc1

Standard InChI:  InChI=1S/C21H20N2O2/c1-15(2)25-19-11-8-16(9-12-19)18-10-13-20(22-14-18)23-21(24)17-6-4-3-5-7-17/h3-15H,1-2H3,(H,22,23,24)

Standard InChI Key:  BMNULMKLPBTBJN-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   16.7152  -22.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7141  -23.4232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4289  -23.8360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.1453  -23.4227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1425  -22.5922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4271  -22.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8605  -23.8341    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.5743  -23.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2894  -23.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2860  -24.6553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0003  -25.0666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7151  -24.6529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.7111  -23.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9963  -23.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5730  -22.5954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.0028  -22.1836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0039  -21.3575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2902  -20.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5748  -21.3580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5777  -22.1873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2920  -22.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8597  -20.9466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8584  -20.1216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1433  -19.7102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5722  -19.7080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  6  1  1  0
 12 13  1  0
  1  2  2  0
 13 14  2  0
 14  9  1  0
  4  7  1  0
  8 15  2  0
  3  4  2  0
  7  8  1  0
 16 17  2  0
 17 18  1  0
  8  9  1  0
 18 19  2  0
  4  5  1  0
 19 20  1  0
  9 10  2  0
 20 21  2  0
 21 16  1  0
  1 16  1  0
  2  3  1  0
 19 22  1  0
 10 11  1  0
 22 23  1  0
  5  6  2  0
 23 24  1  0
 11 12  2  0
 23 25  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Luciferase (58 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 332.40Molecular Weight (Monoisotopic): 332.1525AlogP: 4.79#Rotatable Bonds: 5
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 2.26CX LogP: 4.70CX LogD: 4.70
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.73Np Likeness Score: -1.31

References

1. Heitman LH, van Veldhoven JP, Zweemer AM, Ye K, Brussee J, IJzerman AP..  (2008)  False positives in a reporter gene assay: identification and synthesis of substituted N-pyridin-2-ylbenzamides as competitive inhibitors of firefly luciferase.,  51  (15): [PMID:18646744] [10.1021/jm8004509]

Source