The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-tert-Butyl-1-m-tolyl-1H-pyrazol-5-yl)-3-(3-(6-nitroquinazolin-4-ylamino)phenyl)urea ID: ALA526560
PubChem CID: 44186374
Max Phase: Preclinical
Molecular Formula: C29H28N8O3
Molecular Weight: 536.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2cccc(Nc3ncnc4ccc([N+](=O)[O-])cc34)c2)c1
Standard InChI: InChI=1S/C29H28N8O3/c1-18-7-5-10-21(13-18)36-26(16-25(35-36)29(2,3)4)34-28(38)33-20-9-6-8-19(14-20)32-27-23-15-22(37(39)40)11-12-24(23)30-17-31-27/h5-17H,1-4H3,(H,30,31,32)(H2,33,34,38)
Standard InChI Key: KYFLIYLKGJJPKB-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
14.6674 -17.8515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3846 -17.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0963 -17.8610 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.3901 -16.6188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8135 -17.4532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9061 -16.6346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7142 -16.4684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1220 -17.1857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5658 -17.7950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.7315 -18.6032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5160 -18.8589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6819 -19.6662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0645 -20.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2786 -19.9504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1164 -19.1436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4648 -19.9264 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0547 -15.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4625 -15.0083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3206 -15.3406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7925 -16.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6819 -19.1041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6807 -19.9315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3956 -20.3444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3938 -18.6914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1091 -19.1005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1099 -19.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8252 -20.3383 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5402 -19.9235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5355 -19.0936 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8196 -18.6863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8152 -17.8614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.5275 -17.4451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2395 -17.8572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9513 -17.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9474 -16.6157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2257 -16.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5169 -16.6252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9673 -18.6918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9689 -17.8634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.2548 -19.1011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 5 1 0
17 20 1 0
9 10 1 0
5 6 2 0
21 22 2 0
10 11 2 0
22 23 1 0
23 26 2 0
2 3 1 0
25 24 2 0
24 21 1 0
11 12 1 0
1 2 1 0
25 26 1 0
12 13 2 0
26 27 1 0
2 4 2 0
27 28 2 0
13 14 1 0
28 29 1 0
29 30 2 0
30 25 1 0
14 15 2 0
30 31 1 0
15 10 1 0
31 32 1 0
6 7 1 0
32 33 2 0
12 16 1 0
33 34 1 0
7 8 2 0
34 35 2 0
7 17 1 0
35 36 1 0
8 9 1 0
36 37 2 0
37 32 1 0
17 18 1 0
21 38 1 0
9 5 1 0
17 19 1 0
38 39 1 0
38 40 2 0
34 1 1 0
M CHG 2 38 1 39 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 536.60Molecular Weight (Monoisotopic): 536.2284AlogP: 6.72#Rotatable Bonds: 6Polar Surface Area: 139.90Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.34CX Basic pKa: 3.17CX LogP: 7.16CX LogD: 7.16Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.16Np Likeness Score: -2.06
References 1. Getlik M, Grütter C, Simard JR, Klüter S, Rabiller M, Rode HB, Robubi A, Rauh D.. (2009) Hybrid compound design to overcome the gatekeeper T338M mutation in cSrc., 52 (13): [PMID:19462975 ] [10.1021/jm9002928 ]