1-(3-((3aS,4R,8aS,8bR)-4-(5-(5-chlorothiophen-2-yl)isoxazol-3-yl)-1,3-dioxooctahydropyrrolo[3,4-a]pyrrolizin-2(3H)-yl)propyl)-1-(2-hydroxyethyl)pyrrolidin-1-ium

ID: ALA5266057

Max Phase: Preclinical

Molecular Formula: C25H32ClN4O4S+

Molecular Weight: 520.08

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1[C@@H]2[C@H](C(=O)N1CCC[N+]1(CCO)CCCC1)[C@H](c1cc(-c3ccc(Cl)s3)on1)N1CCC[C@@H]21

Standard InChI:  InChI=1S/C25H32ClN4O4S/c26-20-7-6-19(35-20)18-15-16(27-34-18)23-22-21(17-5-3-8-28(17)23)24(32)29(25(22)33)9-4-12-30(13-14-31)10-1-2-11-30/h6-7,15,17,21-23,31H,1-5,8-14H2/q+1/t17-,21-,22-,23-/m0/s1

Standard InChI Key:  NGWQPUFWVMNLQW-ZMVGRULKSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
    0.1644    0.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5030    1.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2480    2.1957    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5769    2.1957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8318    1.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8318    2.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5030    2.9803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1645    3.4652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4193    0.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4991    0.9261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2441    0.1415    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067   -0.5730    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2962    1.1396    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4190    0.3426    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5244    1.8853    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3133    2.4554    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3000    1.1974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5956    0.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4193    0.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6327    1.2673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9410    1.7164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0027   -0.1128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8737   -0.9273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6086   -1.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1918   -0.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8173    0.0162    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9888   -0.9322    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.6567   -0.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4819   -0.5730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8945   -1.2876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7196   -1.2876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2043   -0.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9888   -0.8752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9888   -1.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2043   -1.9548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5061   -2.0847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0895   -2.6682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8760   -3.4652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  4  6  1  0
  3  7  1  0
  7  8  1  0
  8  6  1  0
  1  9  1  0
  5 10  1  0
 10 11  1  0
 11  9  1  0
  9 12  2  0
 10 13  2  0
  1 14  1  1
  5 15  1  1
  4 16  1  6
  2 17  1  6
 18 17  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 17  2  0
 22 19  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 22  1  0
 25 27  1  0
 11 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 32 31  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 31  1  0
 31 36  1  0
 36 37  1  0
 37 38  1  0
M  CHG  1  31   1
M  END

Alternative Forms

  1. Parent:

    ALA5266057

    ---

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 520.08Molecular Weight (Monoisotopic): 519.1827AlogP: 3.17#Rotatable Bonds: 8
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.97CX Basic pKa: 7.89CX LogP: -2.42CX LogD: -3.04
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.62

References

1. Patel NR, Patel DV, Murumkar PR, Yadav MR..  (2016)  Contemporary developments in the discovery of selective factor Xa inhibitors: A review.,  121  [PMID:27322757] [10.1016/j.ejmech.2016.05.039]

Source