The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(3-((3aS,4R,8aS,8bR)-4-(5-(5-chlorothiophen-2-yl)isoxazol-3-yl)-1,3-dioxooctahydropyrrolo[3,4-a]pyrrolizin-2(3H)-yl)propyl)-1-(2-hydroxyethyl)pyrrolidin-1-ium ID: ALA5266057
Max Phase: Preclinical
Molecular Formula: C25H32ClN4O4S+
Molecular Weight: 520.08
Associated Items:
Names and Identifiers Canonical SMILES: O=C1[C@@H]2[C@H](C(=O)N1CCC[N+]1(CCO)CCCC1)[C@H](c1cc(-c3ccc(Cl)s3)on1)N1CCC[C@@H]21
Standard InChI: InChI=1S/C25H32ClN4O4S/c26-20-7-6-19(35-20)18-15-16(27-34-18)23-22-21(17-5-3-8-28(17)23)24(32)29(25(22)33)9-4-12-30(13-14-31)10-1-2-11-30/h6-7,15,17,21-23,31H,1-5,8-14H2/q+1/t17-,21-,22-,23-/m0/s1
Standard InChI Key: NGWQPUFWVMNLQW-ZMVGRULKSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
0.1644 0.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5030 1.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2480 2.1957 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5769 2.1957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8318 1.4110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8318 2.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5030 2.9803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1645 3.4652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4193 0.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4991 0.9261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2441 0.1415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -0.5730 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2962 1.1396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4190 0.3426 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5244 1.8853 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.3133 2.4554 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3000 1.1974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5956 0.4275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4193 0.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6327 1.2673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9410 1.7164 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0027 -0.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8737 -0.9273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6086 -1.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1918 -0.7186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8173 0.0162 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9888 -0.9322 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.6567 -0.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4819 -0.5730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8945 -1.2876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7196 -1.2876 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2043 -0.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9888 -0.8752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9888 -1.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2043 -1.9548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5061 -2.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0895 -2.6682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8760 -3.4652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
4 6 1 0
3 7 1 0
7 8 1 0
8 6 1 0
1 9 1 0
5 10 1 0
10 11 1 0
11 9 1 0
9 12 2 0
10 13 2 0
1 14 1 1
5 15 1 1
4 16 1 6
2 17 1 6
18 17 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 17 2 0
22 19 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 22 1 0
25 27 1 0
11 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
32 31 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 31 1 0
31 36 1 0
36 37 1 0
37 38 1 0
M CHG 1 31 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 520.08Molecular Weight (Monoisotopic): 519.1827AlogP: 3.17#Rotatable Bonds: 8Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.97CX Basic pKa: 7.89CX LogP: -2.42CX LogD: -3.04Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.43Np Likeness Score: -0.62
References 1. Patel NR, Patel DV, Murumkar PR, Yadav MR.. (2016) Contemporary developments in the discovery of selective factor Xa inhibitors: A review., 121 [PMID:27322757 ] [10.1016/j.ejmech.2016.05.039 ]