N-hexadecyl-N-(2-hydroxyethyl)morpholinium bromide

ID: ALA5266193

Max Phase: Preclinical

Molecular Formula: C22H46BrNO2

Molecular Weight: 356.62

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCCCCCCC[N+]1(CCO)CCOCC1.[Br-]

Standard InChI:  InChI=1S/C22H46NO2.BrH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23(17-20-24)18-21-25-22-19-23;/h24H,2-22H2,1H3;1H/q+1;/p-1

Standard InChI Key:  VMRYLQOSLPEFDA-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 26 25  0  0  0  0  0  0  0  0999 V2000
   17.2559  -18.6468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2559  -19.4640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9612  -19.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6665  -19.4640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6665  -18.6468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9612  -18.2341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0678  -20.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3691  -19.0513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0798  -19.4545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7845  -19.0406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6545  -20.8748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0585  -21.5852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.4952  -19.4439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1998  -19.0300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9106  -19.4332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.6152  -19.0193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.3260  -19.4226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0306  -19.0086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.7414  -19.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4460  -18.9980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.1567  -19.4012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.8613  -18.9873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.5721  -19.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.2767  -18.9767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.9875  -19.3799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8420  -20.5330    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  4  7  1  0
  4  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  1  0
 11 12  1  0
 10 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
M  CHG  2   4   1  26  -1
M  END

Associated Targets(non-human)

CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 356.62Molecular Weight (Monoisotopic): 356.3523AlogP: 5.31#Rotatable Bonds: 17
Polar Surface Area: 29.46Molecular Species: NEUTRALHBA: 2HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.97CX Basic pKa: CX LogP: 1.78CX LogD: 1.78
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.28Np Likeness Score: 0.18

References

1. Soukup O, Benkova M, Dolezal R, Sleha R, Malinak D, Salajkova S, Markova A, Hympanova M, Prchal L, Ryskova L, Hobzova L, Sepčić K, Gunde-Cimerman N, Korabecny J, Jun D, Bostikova V, Bostik P, Marek J..  (2020)  The wide-spectrum antimicrobial effect of novel N-alkyl monoquaternary ammonium salts and their mixtures; the QSAR study against bacteria.,  206  [PMID:32853858] [10.1016/j.ejmech.2020.112584]

Source