1-((1S,3aS,3bR,5aS,6aS,7aR,8aS,8bS,10aS)-8a,10a-dimethylhexadecahydro-1H-cyclopenta[7,8]phenanthro[2,3-b]oxiren-1-yl)ethan-1-one

ID: ALA5266289

Max Phase: Preclinical

Molecular Formula: C21H32O2

Molecular Weight: 316.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H]5O[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C21H32O2/c1-12(22)15-6-7-16-14-5-4-13-10-18-19(23-18)11-21(13,3)17(14)8-9-20(15,16)2/h13-19H,4-11H2,1-3H3/t13-,14-,15+,16-,17-,18-,19+,20+,21-/m0/s1

Standard InChI Key:  UCSWPLHVWDXPMC-WVFTZONGSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   -2.3372   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6228   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083   -1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6228   -1.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3372   -1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0499   -1.0215    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3372   -2.2592    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1938   -1.8465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5206   -1.4340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5206   -0.6090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1938   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1938    0.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5207    1.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2352    0.6285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2351   -0.1965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0179   -0.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5099    0.2250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0392    0.8785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2528    1.6757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6692    2.2592    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0499    1.8893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3254   -1.0168    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3266    1.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1938   -1.0217    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5206    0.2161    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083   -2.2592    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9083    0.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3372    0.2162    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  1  6  1  0
  6  7  1  0
  1  7  1  0
  6  8  1  1
  4  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  3 12  1  0
 12 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 19 18  1  0
 15 19  1  0
 19 20  1  1
 20 21  2  0
 20 22  1  0
 16 23  1  6
 15 24  1  1
 12 25  1  6
 11 26  1  1
  4 27  1  6
  3 28  1  1
  1 29  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5266289

    ---

Associated Targets(non-human)

Gabrp GABA-A receptor; anion channel (5731 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 316.49Molecular Weight (Monoisotopic): 316.2402AlogP: 4.61#Rotatable Bonds: 1
Polar Surface Area: 29.60Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.07CX LogD: 4.07
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.66Np Likeness Score: 2.47

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source