(1R,2S,3R,4S)-bicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid

ID: ALA5266781

Max Phase: Preclinical

Molecular Formula: C9H10O4

Molecular Weight: 182.17

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)[C@@H]1[C@H](C(=O)O)[C@@H]2C=C[C@H]1C2

Standard InChI:  InChI=1S/C9H10O4/c10-8(11)6-4-1-2-5(3-4)7(6)9(12)13/h1-2,4-7H,3H2,(H,10,11)(H,12,13)/t4-,5+,6-,7+

Standard InChI Key:  NIDNOXCRFUCAKQ-UMRXKNAASA-N

Molfile:  

 
     RDKit          2D

 15 16  0  0  0  0  0  0  0  0999 V2000
   -1.0715    1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570    1.4434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    1.0309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0715    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3570   -1.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0713   -1.4434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7857    0.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -1.0310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4884    0.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -0.2063    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714    1.4433    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  1
  7  8  1  0
  7  9  2  0
  4 10  1  1
 10 11  2  0
 10 12  1  0
  6 13  1  0
  3 13  1  0
  6 14  1  6
  3 15  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5266781

    ---

Associated Targets(non-human)

Vibrio harveyi (399 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 182.17Molecular Weight (Monoisotopic): 182.0579AlogP: 0.59#Rotatable Bonds: 2
Polar Surface Area: 74.60Molecular Species: ACIDHBA: 2HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 3.74CX Basic pKa: CX LogP: 0.42CX LogD: -4.48
Aromatic Rings: Heavy Atoms: 13QED Weighted: 0.61Np Likeness Score: 0.29

References

1. Chen J, Lu Y, Ye X, Emam M, Zhang H, Wang H..  (2020)  Current advances in Vibrio harveyi quorum sensing as drug discovery targets.,  207  [PMID:32871343] [10.1016/j.ejmech.2020.112741]

Source