The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((S)-1-(((S)-6-(3,4-dichloro-5-methyl-1H-pyrrole-2-carboxamido)-4,5,6,7-tetrahydrobenzo[d]thiazol-2-yl)amino)-3-methyl-1-oxobutan-2-yl)-5-hydroxy-4-oxo-1,4-dihydropyridine-2-carboxamide ID: ALA5266830
Max Phase: Preclinical
Molecular Formula: C24H26Cl2N6O5S
Molecular Weight: 581.48
Associated Items:
Names and Identifiers Canonical SMILES: Cc1[nH]c(C(=O)N[C@H]2CCc3nc(NC(=O)[C@@H](NC(=O)c4cc(=O)c(O)c[nH]4)C(C)C)sc3C2)c(Cl)c1Cl
Standard InChI: InChI=1S/C24H26Cl2N6O5S/c1-9(2)19(31-21(35)13-7-14(33)15(34)8-27-13)22(36)32-24-30-12-5-4-11(6-16(12)38-24)29-23(37)20-18(26)17(25)10(3)28-20/h7-9,11,19,28,34H,4-6H2,1-3H3,(H,27,33)(H,29,37)(H,31,35)(H,30,32,36)/t11-,19-/m0/s1
Standard InChI Key: RGSYWFKWPTYADN-WLRWDXFRSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
4.6781 -2.8551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8916 -2.0582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3082 -1.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5218 -0.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3187 -0.4642 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9021 -1.0476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6885 -1.8446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2719 -2.4280 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9383 -0.0944 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1519 0.7025 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1414 -0.3079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5579 0.2754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7715 1.0724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1881 1.6558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5685 1.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7610 0.0619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5474 -0.7350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1776 0.6453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3806 0.4317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0849 -0.2951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7389 -0.2951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3223 -0.8785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1192 -0.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3327 0.1319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7494 0.7153 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9524 0.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2605 0.9510 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1297 0.3454 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3432 1.1423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7598 1.7258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1402 1.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8076 0.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8076 0.0460 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.4750 1.3559 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2719 1.1423 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.2201 2.1406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6326 2.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3951 2.1406 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 1 0
7 6 2 0
2 7 1 0
7 8 1 0
9 4 1 0
9 10 2 0
11 9 1 0
12 11 1 0
12 13 1 6
13 14 1 0
13 15 1 0
16 12 1 0
16 17 2 0
18 16 1 0
19 18 1 0
19 20 2 0
21 20 1 0
22 21 1 0
23 22 1 0
24 23 1 0
25 24 1 0
26 25 1 0
21 26 2 0
26 27 1 0
27 19 1 0
24 28 1 6
29 28 1 0
29 30 2 0
31 29 1 0
31 32 2 0
32 33 1 0
32 34 1 0
34 35 1 0
34 36 2 0
36 37 1 0
36 38 1 0
38 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 581.48Molecular Weight (Monoisotopic): 580.1062AlogP: 3.16#Rotatable Bonds: 7Polar Surface Area: 169.07Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 7.74CX Basic pKa: ┄CX LogP: 2.83CX LogD: 2.67Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.25Np Likeness Score: -1.16
References 1. He M, Fan M, Peng Z, Wang G.. (2021) An overview of hydroxypyranone and hydroxypyridinone as privileged scaffolds for novel drug discovery., 221 [PMID:34023737 ] [10.1016/j.ejmech.2021.113546 ]