The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,5-dimethoxybenzyl)-3-methoxybenzo[b]thiophene-2-carboxamide ID: ALA5266845
Max Phase: Preclinical
Molecular Formula: C19H19NO4S
Molecular Weight: 357.43
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(CNC(=O)c2sc3ccccc3c2OC)cc(OC)c1
Standard InChI: InChI=1S/C19H19NO4S/c1-22-13-8-12(9-14(10-13)23-2)11-20-19(21)18-17(24-3)15-6-4-5-7-16(15)25-18/h4-10H,11H2,1-3H3,(H,20,21)
Standard InChI Key: HHSVPADNGSGMDD-UHFFFAOYSA-N
Molfile:
RDKit 2D
25 27 0 0 0 0 0 0 0 0999 V2000
-3.8105 -0.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8116 -1.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0988 -2.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1006 -0.5547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3873 -0.9626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3825 -1.7912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5929 -2.0427 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.1097 -1.3695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6008 -0.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3512 0.0817 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5476 0.2574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2871 -1.3647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1283 -2.0746 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1199 -0.6499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9424 -0.6450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3495 0.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1707 0.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5777 0.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1622 1.4981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3354 1.4905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9320 0.7760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4004 0.7872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8116 1.4995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9241 2.2029 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1016 2.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
4 1 1 0
5 4 2 0
3 6 2 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
9 10 1 0
10 11 1 0
8 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
18 22 1 0
22 23 1 0
20 24 1 0
24 25 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 357.43Molecular Weight (Monoisotopic): 357.1035AlogP: 3.86#Rotatable Bonds: 6Polar Surface Area: 56.79Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.31CX LogD: 3.31Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.73Np Likeness Score: -1.11
References 1. Spanò V, Venturini A, Genovese M, Barreca M, Raimondi MV, Montalbano A, Galietta LJV, Barraja P.. (2020) Current development of CFTR potentiators in the last decade., 204 [PMID:32898816 ] [10.1016/j.ejmech.2020.112631 ]