The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2,6-dimethoxy-4-(2-methyl-1-oxo-1,2-dihydro-2,7-naphthyridin-4-yl)benzyl)(methyl)amino)-N-(2-(2-(2-((2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindolin-4-yl)amino)ethoxy)ethoxy)ethyl)acetamide ID: ALA5267184
Max Phase: Preclinical
Molecular Formula: C40H45N7O10
Molecular Weight: 783.84
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(-c2cn(C)c(=O)c3cnccc23)cc(OC)c1CN(C)CC(=O)NCCOCCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O
Standard InChI: InChI=1S/C40H45N7O10/c1-45(21-29-32(54-3)18-24(19-33(29)55-4)28-22-46(2)38(51)27-20-41-11-10-25(27)28)23-35(49)43-13-15-57-17-16-56-14-12-42-30-7-5-6-26-36(30)40(53)47(39(26)52)31-8-9-34(48)44-37(31)50/h5-7,10-11,18-20,22,31,42H,8-9,12-17,21,23H2,1-4H3,(H,43,49)(H,44,48,50)
Standard InChI Key: AIOCFZJGGGEWDK-UHFFFAOYSA-N
Molfile:
RDKit 2D
57 62 0 0 0 0 0 0 0 0999 V2000
-6.9314 3.4075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9314 2.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2169 2.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5024 2.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5024 3.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2169 3.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2169 4.6453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 3.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0735 3.4075 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0735 2.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7880 2.1701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2169 1.3448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9299 0.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9299 0.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2180 -0.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5031 0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5031 0.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7884 -0.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0737 0.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2180 -1.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5033 -1.5413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.5033 -2.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7886 -1.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0739 -1.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3592 -1.1287 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6445 -1.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9299 -1.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2152 -1.5413 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5005 -1.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2141 -1.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9288 -1.1287 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6435 -1.5413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3582 -1.1287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0728 -1.5413 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0728 -2.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 -2.7794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7867 -3.6022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0718 -4.0149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3551 -3.6058 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3551 -2.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5671 -3.8481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0583 -3.1830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5895 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8031 -1.7336 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8835 -3.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2962 -3.8976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1214 -3.8976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.5340 -3.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1214 -2.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2961 -2.4682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3592 -3.1830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8835 -4.6123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7807 -4.6453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0739 -2.3666 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.6446 -0.3069 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.3592 0.1056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6461 3.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 1 0
6 7 2 0
5 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
4 11 1 0
12 3 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 12 2 0
16 18 1 0
18 19 1 0
15 20 1 0
20 21 1 0
21 22 1 0
21 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
36 35 2 0
37 36 1 0
38 37 2 0
39 38 1 0
40 39 2 0
35 40 1 0
37 41 1 0
41 42 1 0
43 42 1 0
36 43 1 0
43 44 2 0
45 42 1 0
45 46 1 0
46 47 1 0
47 48 1 0
48 49 1 0
49 50 1 0
45 50 1 0
48 51 2 0
46 52 2 0
41 53 2 0
24 54 2 0
14 55 1 0
55 56 1 0
1 57 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: YesParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 783.84Molecular Weight (Monoisotopic): 783.3228AlogP: 1.71#Rotatable Bonds: 18Polar Surface Area: 199.73Molecular Species: NEUTRALHBA: 14HBD: 3#RO5 Violations: 2HBA (Lipinski): 17HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.59CX Basic pKa: 5.70CX LogP: 0.16CX LogD: 0.15Aromatic Rings: 4Heavy Atoms: 57QED Weighted: 0.10Np Likeness Score: -0.75
References 1. Wang C, Zhang Y, Wu Y, Xing D.. (2021) Developments of CRBN-based PROTACs as potential therapeutic agents., 225 [PMID:34411892 ] [10.1016/j.ejmech.2021.113749 ] 2. Zoppi V, Hughes SJ, Maniaci C, Testa A, Gmaschitz T, Wieshofer C, Koegl M, Riching KM, Daniels DL, Spallarossa A, Ciulli A.. (2019) Iterative Design and Optimization of Initially Inactive Proteolysis Targeting Chimeras (PROTACs) Identify VZ185 as a Potent, Fast, and Selective von Hippel-Lindau (VHL) Based Dual Degrader Probe of BRD9 and BRD7., 62 (2): [PMID:30540463 ] [10.1021/acs.jmedchem.8b01413 ]