The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(Furan-2-yl)-1-(pyrimidyl-2-yl)-1H-pyrrol-3-yl)(3,4,5-trimethoxyphenyl)methanone ID: ALA5267195
Max Phase: Preclinical
Molecular Formula: C22H19N3O5
Molecular Weight: 405.41
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(C(=O)c2cn(-c3ncccn3)cc2-c2ccco2)cc(OC)c1OC
Standard InChI: InChI=1S/C22H19N3O5/c1-27-18-10-14(11-19(28-2)21(18)29-3)20(26)16-13-25(22-23-7-5-8-24-22)12-15(16)17-6-4-9-30-17/h4-13H,1-3H3
Standard InChI Key: IXBOSJOTMWEKPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-2.1267 1.5996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6507 0.9258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8246 0.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5813 0.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2532 -0.3517 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9175 0.1437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2618 -1.1767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5487 -1.5999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5538 -2.4291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2792 -2.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9924 -2.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9800 -1.5826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3307 1.5767 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6562 2.3348 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4883 1.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8132 0.7165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6324 0.6192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1302 1.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8053 2.0401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9827 2.1451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3030 2.6981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1217 2.5960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9490 1.1763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2710 0.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9556 -0.1398 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4598 -0.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9484 1.5243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2710 2.3023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6630 2.8307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9533 2.4017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
2 6 2 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
3 13 1 0
13 14 2 0
13 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
15 20 1 0
19 21 1 0
21 22 1 0
18 23 1 0
23 24 1 0
17 25 1 0
25 26 1 0
27 1 1 0
27 28 1 0
28 29 2 0
30 29 1 0
1 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.41Molecular Weight (Monoisotopic): 405.1325AlogP: 3.78#Rotatable Bonds: 7Polar Surface Area: 88.61Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 0.38CX LogP: 3.38CX LogD: 3.38Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.43Np Likeness Score: -0.71
References 1. Puxeddu M, Wu J, Bai R, D'Ambrosio M, Nalli M, Coluccia A, Manetto S, Ciogli A, Masci D, Urbani A, Fionda C, Coni S, Bordone R, Canettieri G, Bigogno C, Dondio G, Hamel E, Liu T, Silvestri R, La Regina G.. (2022) Induction of Ferroptosis in Glioblastoma and Ovarian Cancers by a New Pyrrole Tubulin Assembly Inhibitor., 65 (23.0): [PMID:36395526 ] [10.1021/acs.jmedchem.2c01457 ]