3-(3-amino-4-methoxyphenyl)-4H-chromen-4-one

ID: ALA5267451

Max Phase: Preclinical

Molecular Formula: C16H13NO3

Molecular Weight: 267.28

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2coc3ccccc3c2=O)cc1N

Standard InChI:  InChI=1S/C16H13NO3/c1-19-15-7-6-10(8-13(15)17)12-9-20-14-5-3-2-4-11(14)16(12)18/h2-9H,17H2,1H3

Standard InChI Key:  FMDVICPTGUSZQW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 22  0  0  0  0  0  0  0  0999 V2000
    2.0313    0.3563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3168   -0.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3168   -0.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0313   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7459   -0.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7459   -0.0561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4604    0.3564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4604    1.1815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0312    1.1815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6023   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1121   -0.8812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8268   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8267   -2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1122   -2.5315    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6023   -2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5415   -0.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2560   -1.2938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2559   -2.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5412   -2.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1121   -0.0561    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  1  9  1  0
 10 11  1  0
 10 15  2  0
 11 12  1  0
 12 13  2  0
  3 10  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 12 16  1  0
 19 13  1  0
 13 14  1  0
 14 15  1  0
 11 20  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5267451

    ---

Associated Targets(non-human)

Ahr Aryl hydrocarbon receptor (8 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 267.28Molecular Weight (Monoisotopic): 267.0895AlogP: 3.05#Rotatable Bonds: 2
Polar Surface Area: 65.46Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.62CX LogP: 2.35CX LogD: 2.35
Aromatic Rings: 3Heavy Atoms: 20QED Weighted: 0.72Np Likeness Score: 0.29

References

1. Lin L, Dai Y, Xia Y..  (2022)  An overview of aryl hydrocarbon receptor ligands in the Last two decades (2002-2022): A medicinal chemistry perspective.,  244  [PMID:36274276] [10.1016/j.ejmech.2022.114845]

Source