isopropyl 1-(naphthalen-1-yl)-9H-pyrido[3,4-b]indole-3-carboxylate

ID: ALA5267462

Max Phase: Preclinical

Molecular Formula: C25H20N2O2

Molecular Weight: 380.45

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)OC(=O)c1cc2c([nH]c3ccccc32)c(-c2cccc3ccccc23)n1

Standard InChI:  InChI=1S/C25H20N2O2/c1-15(2)29-25(28)22-14-20-18-11-5-6-13-21(18)26-24(20)23(27-22)19-12-7-9-16-8-3-4-10-17(16)19/h3-15,26H,1-2H3

Standard InChI Key:  ZJLOWDKUDHWJLF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
    1.2132   -2.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4990   -2.0557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4990   -1.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2098   -0.8258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9222   -1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9222   -2.0545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2137   -0.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9304   -1.2357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9304   -2.0592    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2147   -2.4679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2137    0.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9264    0.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9264    1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2155    1.6425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4927    1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4927    0.4117    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2064    1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2064    2.4687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9199    1.2327    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6336    1.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3472    1.2327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6336    2.4687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7102    1.4870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1947    0.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7102    0.1533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0117    0.9067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3472    1.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8667    2.3242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0470    2.2430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  3  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10  2  2  0
  7 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 15 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 13 23  1  0
 24 23  2  0
 25 24  1  0
 12 25  1  0
 24 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 23 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5267462

    ---

Associated Targets(Human)

OVCAR-3 (48710 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PC-3 (62116 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 380.45Molecular Weight (Monoisotopic): 380.1525AlogP: 6.10#Rotatable Bonds: 3
Polar Surface Area: 54.98Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.91CX Basic pKa: 1.46CX LogP: 5.86CX LogD: 5.86
Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -0.20

References

1. Luo B, Song X..  (2021)  A comprehensive overview of β-carbolines and its derivatives as anticancer agents.,  224  [PMID:34332400] [10.1016/j.ejmech.2021.113688]

Source