The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
isopropyl 1-(naphthalen-1-yl)-9H-pyrido[3,4-b]indole-3-carboxylate ID: ALA5267462
Max Phase: Preclinical
Molecular Formula: C25H20N2O2
Molecular Weight: 380.45
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)c1cc2c([nH]c3ccccc32)c(-c2cccc3ccccc23)n1
Standard InChI: InChI=1S/C25H20N2O2/c1-15(2)29-25(28)22-14-20-18-11-5-6-13-21(18)26-24(20)23(27-22)19-12-7-9-16-8-3-4-10-17(16)19/h3-15,26H,1-2H3
Standard InChI Key: ZJLOWDKUDHWJLF-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 33 0 0 0 0 0 0 0 0999 V2000
1.2132 -2.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4990 -2.0557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4990 -1.2342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2098 -0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9222 -1.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9222 -2.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2137 -0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9304 -1.2357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9304 -2.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2147 -2.4679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2137 0.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9264 0.4080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9264 1.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2155 1.6425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4927 1.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4927 0.4117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2064 1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2064 2.4687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9199 1.2327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6336 1.6447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3472 1.2327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6336 2.4687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7102 1.4870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1947 0.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7102 0.1533 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0117 0.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3472 1.6597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8667 2.3242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0470 2.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
5 4 2 0
6 5 1 0
1 6 2 0
3 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 2 2 0
7 11 1 0
12 11 2 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
11 16 1 0
15 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
13 23 1 0
24 23 2 0
25 24 1 0
12 25 1 0
24 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
23 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.45Molecular Weight (Monoisotopic): 380.1525AlogP: 6.10#Rotatable Bonds: 3Polar Surface Area: 54.98Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.91CX Basic pKa: 1.46CX LogP: 5.86CX LogD: 5.86Aromatic Rings: 5Heavy Atoms: 29QED Weighted: 0.38Np Likeness Score: -0.20