N-(2-(chloromethylene)-4-methoxy-6-(4-methoxy-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)-6-oxohex-4-en-1-yl)-7-hydroxy-N-methylpentadec-4-enamide

ID: ALA5267470

Max Phase: Preclinical

Molecular Formula: C29H45ClN2O6

Molecular Weight: 553.14

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCC(O)C/C=C/CCC(=O)N(C)C/C(=C\Cl)C/C(=C\C(=O)N1CC(OC)=CC1=O)OC

Standard InChI:  InChI=1S/C29H45ClN2O6/c1-5-6-7-8-9-11-14-24(33)15-12-10-13-16-27(34)31(2)21-23(20-30)17-25(37-3)18-28(35)32-22-26(38-4)19-29(32)36/h10,12,18-20,24,33H,5-9,11,13-17,21-22H2,1-4H3/b12-10+,23-20-,25-18+

Standard InChI Key:  OBKZPRQPHKITSE-ICSWWSCWSA-N

Molfile:  

 
     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   -7.4269   -1.4341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7124   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9977   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2830   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5683   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8536   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1390   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4243   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7096   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9949   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2803   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4343   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1490   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8637   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5784   -1.4343    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2931   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0077   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7224   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4371   -1.4343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1518   -1.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1518   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8665    0.2161    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8665    1.0413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6707    1.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1415    0.6379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6494   -0.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8630   -0.8268    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8842    2.0886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3007    2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4371    0.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4371   -2.2595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1518   -2.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0077   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2931   -2.6722    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.5784   -2.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8637   -0.1964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4243   -0.1964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1415   -1.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 23 22  1  0
 23 24  1  0
 24 25  2  0
 26 25  1  0
 22 26  1  0
 26 27  2  0
 24 28  1  0
 28 29  1  0
 21 30  2  0
 19 31  1  0
 31 32  1  0
 17 33  2  0
 33 34  1  0
 15 35  1  0
 14 36  2  0
  8 37  1  0
  1 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5267470

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 553.14Molecular Weight (Monoisotopic): 552.2966AlogP: 5.23#Rotatable Bonds: 19
Polar Surface Area: 96.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.32CX Basic pKa: CX LogP: 3.52CX LogD: 3.52
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.10Np Likeness Score: 1.22

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source