The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(2-(chloromethylene)-4-methoxy-6-(4-methoxy-2-oxo-2,5-dihydro-1H-pyrrol-1-yl)-6-oxohex-4-en-1-yl)-7-hydroxy-N-methylpentadec-4-enamide ID: ALA5267470
Max Phase: Preclinical
Molecular Formula: C29H45ClN2O6
Molecular Weight: 553.14
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCC(O)C/C=C/CCC(=O)N(C)C/C(=C\Cl)C/C(=C\C(=O)N1CC(OC)=CC1=O)OC
Standard InChI: InChI=1S/C29H45ClN2O6/c1-5-6-7-8-9-11-14-24(33)15-12-10-13-16-27(34)31(2)21-23(20-30)17-25(37-3)18-28(35)32-22-26(38-4)19-29(32)36/h10,12,18-20,24,33H,5-9,11,13-17,21-22H2,1-4H3/b12-10+,23-20-,25-18+
Standard InChI Key: OBKZPRQPHKITSE-ICSWWSCWSA-N
Molfile:
RDKit 2D
38 38 0 0 0 0 0 0 0 0999 V2000
-7.4269 -1.4341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7124 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9977 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2830 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5683 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8536 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1390 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4243 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7096 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9949 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2803 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4343 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1490 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8637 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5784 -1.4343 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2931 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0077 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7224 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4371 -1.4343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1518 -1.0217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1518 -0.1964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8665 0.2161 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8665 1.0413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6707 1.2915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1415 0.6379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6494 -0.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8630 -0.8268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8842 2.0886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3007 2.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4371 0.2161 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4371 -2.2595 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1518 -2.6722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0077 -2.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2931 -2.6722 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5784 -2.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8637 -0.1964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4243 -0.1964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.1415 -1.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
23 22 1 0
23 24 1 0
24 25 2 0
26 25 1 0
22 26 1 0
26 27 2 0
24 28 1 0
28 29 1 0
21 30 2 0
19 31 1 0
31 32 1 0
17 33 2 0
33 34 1 0
15 35 1 0
14 36 2 0
8 37 1 0
1 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.14Molecular Weight (Monoisotopic): 552.2966AlogP: 5.23#Rotatable Bonds: 19Polar Surface Area: 96.38Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.32CX Basic pKa: ┄CX LogP: 3.52CX LogD: 3.52Aromatic Rings: ┄Heavy Atoms: 38QED Weighted: 0.10Np Likeness Score: 1.22
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]