(S,E)-2-{4-[2-Hydroxy-3-(1H-indol-1-yl)-propoxy]phenyl}-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one

ID: ALA5267596

Max Phase: Preclinical

Molecular Formula: C27H25NO6

Molecular Weight: 459.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(O)c2c(c1)O[C@H](c1ccc(OCC(O)Cc3c[nH]c4ccccc34)cc1)CC2=O

Standard InChI:  InChI=1S/C27H25NO6/c1-32-20-11-23(30)27-24(31)13-25(34-26(27)12-20)16-6-8-19(9-7-16)33-15-18(29)10-17-14-28-22-5-3-2-4-21(17)22/h2-9,11-12,14,18,25,28-30H,10,13,15H2,1H3/t18?,25-/m0/s1

Standard InChI Key:  QBESQYQRVAZZBF-LYIYLXCWSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -2.6079   -2.3510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6079   -1.5260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8964   -1.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8982   -0.2885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6130    0.1237    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3256   -0.2869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3256   -1.1120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0355   -1.5237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0355   -2.3487    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7518   -1.1157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7518   -0.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4663    0.1251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1807   -0.2873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0373    0.1248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1837    0.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4662   -0.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2455    0.1260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2439    0.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4707    1.3596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1835    0.9489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9584    1.3595    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6729    0.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3874    1.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1019    0.9469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8164    1.3595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3874    2.1845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9026    2.1795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7092    2.3510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1216    1.6369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5697    1.0241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9256    1.4654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1807    0.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6330    0.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8259    0.2364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  5  1  0
  7  6  2  0
  7  2  1  0
  8  7  1  0
  8  9  1  0
 10  8  2  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 14 11  2  0
  6 14  1  0
  4 15  1  6
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 23 26  1  0
 27 25  2  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 25  1  0
 29 31  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 30 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5267596

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 459.50Molecular Weight (Monoisotopic): 459.1682AlogP: 4.57#Rotatable Bonds: 7
Polar Surface Area: 101.01Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 8.69CX Basic pKa: CX LogP: 4.61CX LogD: 4.59
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.37Np Likeness Score: 0.75

References

1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU..  (2020)  Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer.,  28  (23.0): [PMID:33038666] [10.1016/j.bmc.2020.115798]

Source