Delta14,15-anhydro-24-thiocarbonylbufalin

ID: ALA5267626

Max Phase: Preclinical

Molecular Formula: C24H32O2S

Molecular Weight: 384.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H](O)C[C@H]1CC[C@H]1C3=CC[C@H](c4ccc(=S)oc4)[C@@]3(C)CC[C@@H]12

Standard InChI:  InChI=1S/C24H32O2S/c1-23-11-9-17(25)13-16(23)4-5-18-20-7-6-19(15-3-8-22(27)26-14-15)24(20,2)12-10-21(18)23/h3,7-8,14,16-19,21,25H,4-6,9-13H2,1-2H3/t16-,17+,18+,19-,21+,23+,24-/m1/s1

Standard InChI Key:  PNKAKRKGWNFYID-RXXPFFJOSA-N

Molfile:  

 
     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    2.8372    3.0660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.5682    2.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883    2.1246    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5463    1.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0842    0.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8641    0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1330    1.6945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8422    0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0622   -0.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3630    0.1615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3361   -0.2418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3361   -1.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3630   -1.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0622   -1.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8422   -1.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2993   -0.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3630   -0.6447    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3630   -2.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3361   -2.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0354   -2.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0354   -1.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0354   -0.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7346   -1.0486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4338   -1.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4338   -2.2588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7346   -2.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1330   -2.6622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0354   -3.0660    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3361   -1.8557    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1429    0.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  5  6  1  0
  7  6  2  0
  2  7  1  0
  8  5  1  1
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 13 14  1  0
  9 14  1  0
 14 15  2  0
 15 16  1  0
 16  8  1  0
 13 17  1  1
 13 18  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 21 12  1  0
 21 22  1  1
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 20 26  1  0
 25 27  1  1
 20 28  1  1
 12 29  1  6
  9 30  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5267626

    ---

Associated Targets(Human)

ATP1A1 Tclin Sodium/potassium-transporting ATPase (386 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 384.59Molecular Weight (Monoisotopic): 384.2123AlogP: 6.42#Rotatable Bonds: 1
Polar Surface Area: 33.37Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.84CX LogD: 4.84
Aromatic Rings: 1Heavy Atoms: 27QED Weighted: 0.45Np Likeness Score: 2.77

References

1. Zhong Y, Zhao C, Wu WY, Fan TY, Li NG, Chen M, Duan JA, Shi ZH..  (2020)  Total synthesis, chemical modification and structure-activity relationship of bufadienolides.,  189  [PMID:31945667] [10.1016/j.ejmech.2020.112038]

Source