(4-((1-(tert-butoxycarbonyl)-N-(4-(thiophen-2-yl)thiazol-2-yl)piperidine-4-carboxamido)methyl)phenyl)sulfamic acid

ID: ALA5267672

Max Phase: Preclinical

Molecular Formula: C25H30N4O6S3

Molecular Weight: 578.74

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)(C)OC(=O)N1CCC(C(=O)N(Cc2ccc(NS(=O)(=O)O)cc2)c2nc(-c3cccs3)cs2)CC1

Standard InChI:  InChI=1S/C25H30N4O6S3/c1-25(2,3)35-24(31)28-12-10-18(11-13-28)22(30)29(23-26-20(16-37-23)21-5-4-14-36-21)15-17-6-8-19(9-7-17)27-38(32,33)34/h4-9,14,16,18,27H,10-13,15H2,1-3H3,(H,32,33,34)

Standard InChI Key:  TZCXGHRBDVCSQP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
    0.4172    1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3008    1.4773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0116    1.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7297    1.4900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7371    0.6651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4553    0.2590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1660    0.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8842    0.2717    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5950    0.6906    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5876    1.5156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1587    1.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4405    1.9090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3081    0.6523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4246    2.7084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4202    0.6906    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8086   -0.1065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1320    1.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4027    0.2333    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.2099   -0.5865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5922   -0.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9175    0.1026    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0048   -1.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5922   -2.0897    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1636   -2.7084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8982   -2.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8059   -1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8467    1.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614    1.4707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5614    0.6455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8467    0.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1320    0.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761    0.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9908    0.6455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7055    0.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4202    0.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7055   -0.5924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4202   -0.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2761   -0.5924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 22  1  0
 23 24  1  0
 24 25  2  0
 26 25  1  0
 22 26  2  0
 27 17  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 31 30  1  0
 17 31  1  0
 29 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
 32 38  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5267672

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 578.74Molecular Weight (Monoisotopic): 578.1327AlogP: 5.27#Rotatable Bonds: 7
Polar Surface Area: 129.14Molecular Species: ACIDHBA: 8HBD: 2
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: -1.86CX Basic pKa: CX LogP: 2.29CX LogD: 1.46
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.37Np Likeness Score: -1.90

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source