The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
17-bromo-4,26-epoxyoscillatoxin B2 ID: ALA5267707
Max Phase: Preclinical
Molecular Formula: C32H43BrO10
Molecular Weight: 667.59
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@@H](CC[C@H](C)[C@H]1O[C@@]23C[C@H](OC(=O)C[C@H]([C@@H](C)O)OC(=O)/C=C(\O2)[C@]2(CO2)CC3(C)C)[C@@H]1C)c1cc(O)ccc1Br
Standard InChI: InChI=1S/C32H43BrO10/c1-17(7-10-23(38-6)21-11-20(35)8-9-22(21)33)29-18(2)25-14-32(43-29)30(4,5)15-31(16-39-31)26(42-32)13-28(37)40-24(19(3)34)12-27(36)41-25/h8-9,11,13,17-19,23-25,29,34-35H,7,10,12,14-16H2,1-6H3/b26-13-/t17-,18-,19+,23-,24+,25-,29+,31+,32+/m0/s1
Standard InChI Key: RQKZPFQUSWEPOP-NFFNUYLUSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
-4.3960 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9843 2.6269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5710 1.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2858 0.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2858 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0002 -0.5642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5712 -0.5643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5712 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3577 -2.1864 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.2856 -1.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2856 -2.6269 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.0000 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 -1.8022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1419 -1.3896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4274 -1.8021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1419 -0.5644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4271 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4271 -0.9767 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -1.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0016 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7160 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7160 -1.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4304 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1448 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8593 -0.1517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8593 0.6731 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1448 1.0855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5737 -0.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5737 -1.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2900 -1.8008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2900 -2.6258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -1.3890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0002 -0.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2883 -0.1519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2883 0.6729 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.3258 0.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 1.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4271 0.6734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8564 0.6734 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1418 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7293 2.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3153 1.9112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8564 2.3238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 1
1 3 1 0
2 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
6 8 1 0
8 9 1 0
9 10 1 1
9 11 1 0
11 12 1 6
11 13 1 0
9 14 1 0
14 15 1 0
15 16 2 0
15 17 1 0
18 17 1 0
18 19 1 6
18 20 1 0
20 21 1 1
20 22 1 0
22 23 1 0
23 24 1 6
23 25 1 0
25 26 1 0
26 27 1 0
27 28 1 6
28 29 1 0
27 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
32 34 1 0
34 35 2 0
35 36 1 0
36 30 2 0
36 37 1 0
22 38 1 6
39 38 1 0
39 40 1 6
18 40 1 0
41 39 1 0
4 41 1 0
39 42 1 0
42 43 1 0
42 44 1 0
42 45 1 0
2 45 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.59Molecular Weight (Monoisotopic): 666.2040AlogP: 5.09#Rotatable Bonds: 7Polar Surface Area: 133.28Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.92CX Basic pKa: ┄CX LogP: 5.40CX LogD: 5.39Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.30Np Likeness Score: 1.73
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]