The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1S)-2-[(2S)-2-[[(1S)-1-carboxy-3-phenyl-propyl]amino]propanoyl]isoindoline-1-carboxylic acid ID: ALA5267769
Max Phase: Preclinical
Molecular Formula: C22H24N2O5
Molecular Weight: 396.44
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N1Cc2ccccc2[C@H]1C(=O)O
Standard InChI: InChI=1S/C22H24N2O5/c1-14(23-18(21(26)27)12-11-15-7-3-2-4-8-15)20(25)24-13-16-9-5-6-10-17(16)19(24)22(28)29/h2-10,14,18-19,23H,11-13H2,1H3,(H,26,27)(H,28,29)/t14-,18-,19-/m0/s1
Standard InChI Key: CUKQMSYVQGXHKG-JVPBZIDWSA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
-2.7001 -1.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9856 -0.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9856 -0.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7003 0.2402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7003 1.0654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4141 1.4782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4141 2.3010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6992 2.7138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9825 2.3046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9825 1.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2709 -1.4102 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5562 -0.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1584 -1.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8731 -0.9976 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.9593 -0.1773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7661 -0.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1786 -0.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6265 -1.3331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8401 -2.1302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6373 -2.3438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2566 -2.7138 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0068 -0.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4147 -0.0035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0027 0.7063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1777 0.7063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1584 -2.2355 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5562 -0.1723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7001 -2.2354 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4147 -0.9975 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 6
3 4 1 0
4 5 1 0
6 5 2 0
7 6 1 0
8 7 2 0
9 8 1 0
10 9 2 0
5 10 1 0
2 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
15 14 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 14 1 0
18 19 1 1
19 20 2 0
19 21 1 0
17 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
16 25 1 0
13 26 2 0
12 27 1 1
1 28 2 0
1 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 396.44Molecular Weight (Monoisotopic): 396.1685AlogP: 2.22#Rotatable Bonds: 8Polar Surface Area: 106.94Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.00CX Basic pKa: 7.80CX LogP: 0.08CX LogD: -3.03Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.63Np Likeness Score: -0.03
References 1. Van der Poorten O, Knuhtsen A, Sejer Pedersen D, Ballet S, Tourwé D.. (2016) Side Chain Cyclized Aromatic Amino Acids: Great Tools as Local Constraints in Peptide and Peptidomimetic Design., 59 (24): [PMID:27690430 ] [10.1021/acs.jmedchem.6b01029 ]