The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cynavimigenin B ID: ALA5267819
Max Phase: Preclinical
Molecular Formula: C28H34O6
Molecular Weight: 466.57
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@]1([C@@H](C[C@H]2C(=O)CC=C3C[C@@H](O)CC[C@@]32C)OC(=O)c2ccccc2)C(=O)[C@@]2(C)CC[C@@H]1O2
Standard InChI: InChI=1S/C28H34O6/c1-26-13-11-19(29)15-18(26)9-10-21(30)20(26)16-23(33-24(31)17-7-5-4-6-8-17)28(3)22-12-14-27(2,34-22)25(28)32/h4-9,19-20,22-23,29H,10-16H2,1-3H3/t19-,20-,22-,23+,26-,27+,28+/m0/s1
Standard InChI Key: OHVDWKLUBVXBFO-ZORZAGCHSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-2.8572 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1428 -2.6817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8572 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5719 -2.6818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 -2.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 -2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0006 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 -0.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4302 0.2061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1449 -0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4302 1.0314 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7153 -1.0316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4283 -0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8598 0.2059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5719 -0.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5719 -1.0315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8616 -1.4435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1449 -1.0352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7138 2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0008 2.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 2.2692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7155 1.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4285 2.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4285 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0832 2.0556 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4302 1.8566 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
1 6 1 0
6 7 1 1
4 8 2 0
8 9 1 0
9 10 1 0
10 11 1 0
3 11 1 0
11 12 1 1
12 13 1 0
13 14 1 0
14 15 1 1
13 16 1 6
16 17 1 0
17 18 1 0
17 19 2 0
10 20 2 0
3 21 1 1
22 18 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
18 26 1 0
14 27 1 0
28 27 1 0
29 28 1 0
30 29 1 0
31 30 1 0
14 31 1 0
28 32 1 6
27 33 2 0
28 34 1 0
31 34 1 0
31 35 1 6
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.57Molecular Weight (Monoisotopic): 466.2355AlogP: 4.20#Rotatable Bonds: 5Polar Surface Area: 89.90Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.42CX LogD: 4.42Aromatic Rings: 1Heavy Atoms: 34QED Weighted: 0.52Np Likeness Score: 1.67
References 1. Xue Y, Savchenko AI, Agnew-Francis KA, Miles JA, Holt T, Lu H, Chow S, Forster PI, Boyle GM, Ross BP, Fischer K, Kutateladze AG, Williams CM.. (2023) seco -Pregnane Glycosides from Australian Caustic Vine (Cynanchum viminale subsp. australe )., 86 (3): [PMID:36795946 ] [10.1021/acs.jnatprod.2c01037 ]