The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-(4-carboxybutyl)phenyl)-2-(2-(6-carboxyhexyl)phenyl)diazene 1-oxide ID: ALA5267899
Max Phase: Preclinical
Molecular Formula: C24H30N2O5
Molecular Weight: 426.51
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)CCCCCCc1ccccc1/N=[N+](\[O-])c1ccccc1CCCCC(=O)O
Standard InChI: InChI=1S/C24H30N2O5/c27-23(28)17-4-2-1-3-11-19-12-5-8-15-21(19)25-26(31)22-16-9-6-13-20(22)14-7-10-18-24(29)30/h5-6,8-9,12-13,15-16H,1-4,7,10-11,14,17-18H2,(H,27,28)(H,29,30)/b26-25-
Standard InChI Key: FRXCEMLXRZHLPQ-QPLCGJKRSA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
-3.9313 2.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2167 2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5048 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5048 1.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 1.0311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9313 1.4392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2149 0.2060 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5003 -0.2066 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5003 -1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -0.2066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7857 -1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7865 -2.2673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5014 -2.6800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2132 -2.2708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2180 -1.4461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7902 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0755 1.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3609 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3536 1.4429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0683 1.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7829 1.4429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0711 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3565 -1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3581 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0727 -1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7873 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0683 0.2051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5020 -1.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2166 -1.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9313 -1.4446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2166 -0.2068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
5 7 1 0
7 8 2 0
8 9 1 0
7 10 1 0
11 9 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
9 15 1 0
4 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
11 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
20 27 2 0
26 28 1 0
28 29 1 0
29 30 1 0
29 31 2 0
M CHG 2 7 1 10 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2155AlogP: 5.99#Rotatable Bonds: 14Polar Surface Area: 113.03Molecular Species: ACIDHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.43CX Basic pKa: ┄CX LogP: 4.57CX LogD: 0.17Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.17Np Likeness Score: -0.13
References 1. He X, Peng G, Luo J, Huang JP, Yang J, Yan Y, Gu YC, Wang L, Huang SX.. (2023) O -Alkylazoxymycins A-F, Naturally Occurring Azoxy-Aromatic Compounds from Streptomyces sp. Py50., 86 (1.0): [PMID:36634313 ] [10.1021/acs.jnatprod.2c00892 ]