1-(2-(4-carboxybutyl)phenyl)-2-(2-(6-carboxyhexyl)phenyl)diazene 1-oxide

ID: ALA5267899

Max Phase: Preclinical

Molecular Formula: C24H30N2O5

Molecular Weight: 426.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CCCCCCc1ccccc1/N=[N+](\[O-])c1ccccc1CCCCC(=O)O

Standard InChI:  InChI=1S/C24H30N2O5/c27-23(28)17-4-2-1-3-11-19-12-5-8-15-21(19)25-26(31)22-16-9-6-13-20(22)14-7-10-18-24(29)30/h5-6,8-9,12-13,15-16H,1-4,7,10-11,14,17-18H2,(H,27,28)(H,29,30)/b26-25-

Standard InChI Key:  FRXCEMLXRZHLPQ-QPLCGJKRSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   -3.9313    2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2167    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5048    2.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5048    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2149    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9313    1.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2149    0.2060    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5003   -0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5003   -1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9296   -0.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865   -2.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5014   -2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2132   -2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2180   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7902    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0755    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3609    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3536    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0683    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7829    1.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0711   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3565   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3581   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0727   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7873   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0683    0.2051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5020   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2166   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9313   -1.4446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2166   -0.2068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  7 10  1  0
 11  9  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
  9 15  1  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 20 27  2  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
M  CHG  2   7   1  10  -1
M  END

Alternative Forms

  1. Parent:

    ALA5267899

    ---

Associated Targets(non-human)

Epidermophyton floccosum (561 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2155AlogP: 5.99#Rotatable Bonds: 14
Polar Surface Area: 113.03Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.43CX Basic pKa: CX LogP: 4.57CX LogD: 0.17
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.17Np Likeness Score: -0.13

References

1. He X, Peng G, Luo J, Huang JP, Yang J, Yan Y, Gu YC, Wang L, Huang SX..  (2023)  O-Alkylazoxymycins A-F, Naturally Occurring Azoxy-Aromatic Compounds from Streptomyces sp. Py50.,  86  (1.0): [PMID:36634313] [10.1021/acs.jnatprod.2c00892]

Source