Kleinhospitine B

ID: ALA5268018

Max Phase: Preclinical

Molecular Formula: C30H37NO4

Molecular Weight: 475.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C[C@]2(C=C([C@H]3CC[C@@]4(C)[C@@H]5CC[C@H]6C(C)(C)C(=O)C=C[C@@]67C[C@@]57CC[C@]34C)C(=O)N2)OC1=O

Standard InChI:  InChI=1S/C30H37NO4/c1-17-14-30(35-24(17)34)15-18(23(33)31-30)19-8-10-27(5)21-7-6-20-25(2,3)22(32)9-11-28(20)16-29(21,28)13-12-26(19,27)4/h9,11,14-15,19-21H,6-8,10,12-13,16H2,1-5H3,(H,31,33)/t19-,20+,21+,26-,27+,28-,29+,30-/m1/s1

Standard InChI Key:  LCURYGQDSSFHMK-KWPDOPHASA-N

Molfile:  

 
     RDKit          2D

 38 44  0  0  0  0  0  0  0  0999 V2000
   -2.0050   -3.2533    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050   -2.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -2.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5764   -2.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5764   -1.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5764   -0.7785    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1379   -1.1911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2281   -2.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9204   -1.4369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4122   -0.7696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9417   -0.1163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7532    0.0323    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1553    0.6806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9560    0.8591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0483    1.6831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8401    1.4709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3231    2.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1481    2.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8523    2.7582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0659    3.5552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0483    2.5081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3139    2.0137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7428    1.3951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0822    1.3951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1379   -0.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2293    0.4535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5763    0.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -0.3663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -1.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050   -0.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050   -1.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7193   -1.1910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4335   -1.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4335   -2.4283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1481   -2.8408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7193   -2.8406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3067   -3.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1318   -3.5552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  1
  5  7  1  0
  7  8  1  6
  7  9  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  6
 11 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 19 17  1  0
 19 20  2  0
 21 19  1  0
 15 21  1  6
 22 15  1  0
 23 22  1  0
 23 13  1  0
 23 24  2  0
 25 11  1  0
  7 25  1  0
 25 26  1  1
 25 27  1  0
 27 28  1  0
 29 28  1  0
  5 29  1  0
 29 30  1  1
 31 30  1  1
 31 29  1  0
  2 31  1  0
 31 32  1  0
 33 32  2  0
 33 34  1  0
 34 35  2  0
 34 36  1  0
 36  2  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5268018

    ---

Associated Targets(non-human)

Hepatocyte (2621 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.63Molecular Weight (Monoisotopic): 475.2723AlogP: 5.03#Rotatable Bonds: 1
Polar Surface Area: 72.47Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.62CX Basic pKa: 0.04CX LogP: 5.66CX LogD: 5.66
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.54Np Likeness Score: 2.70

References

1. Xu GB, Xiao YH, Zhang QY, Zhou M, Liao SG..  (2018)  Hepatoprotective natural triterpenoids.,  145  [PMID:29353722] [10.1016/j.ejmech.2018.01.011]

Source