The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-((2,3-dichlorophenyl)thio)-3-nitrocyclopenta-1,3-dien-1-yl)ethan-1-one ID: ALA5268050
Max Phase: Preclinical
Molecular Formula: C13H9Cl2NO3S
Molecular Weight: 330.19
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)C1=CC([N+](=O)[O-])=C(Sc2cccc(Cl)c2Cl)C1
Standard InChI: InChI=1S/C13H9Cl2NO3S/c1-7(17)8-5-10(16(18)19)12(6-8)20-11-4-2-3-9(14)13(11)15/h2-5H,6H2,1H3
Standard InChI Key: RMBWPCTWNQSCQI-UHFFFAOYSA-N
Molfile:
RDKit 2D
20 21 0 0 0 0 0 0 0 0999 V2000
-2.3253 0.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3253 -0.4166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6120 -0.8229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9049 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9049 0.4087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6138 0.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6138 1.6406 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.1933 0.8195 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.1933 -0.8238 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.5182 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5182 0.4086 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3190 0.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7878 0.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2978 -0.6578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5105 -1.4515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3041 -1.6641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9295 -2.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5316 1.4515 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9506 2.0325 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3253 1.6641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
6 7 1 0
5 8 1 0
4 9 1 0
9 10 1 0
11 10 1 0
11 12 1 0
12 13 2 0
14 13 1 0
10 14 2 0
15 14 1 0
15 16 2 0
15 17 1 0
12 18 1 0
18 19 2 0
18 20 1 0
M CHG 2 15 1 17 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 330.19Molecular Weight (Monoisotopic): 328.9680AlogP: 4.49#Rotatable Bonds: 4Polar Surface Area: 60.21Molecular Species: ACIDHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.56CX Basic pKa: ┄CX LogP: 3.27CX LogD: 1.12Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.60Np Likeness Score: -0.76
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]