1-(4-((2,3-dichlorophenyl)thio)-3-nitrocyclopenta-1,3-dien-1-yl)ethan-1-one

ID: ALA5268050

Max Phase: Preclinical

Molecular Formula: C13H9Cl2NO3S

Molecular Weight: 330.19

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)C1=CC([N+](=O)[O-])=C(Sc2cccc(Cl)c2Cl)C1

Standard InChI:  InChI=1S/C13H9Cl2NO3S/c1-7(17)8-5-10(16(18)19)12(6-8)20-11-4-2-3-9(14)13(11)15/h2-5H,6H2,1H3

Standard InChI Key:  RMBWPCTWNQSCQI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   -2.3253    0.4083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3253   -0.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6120   -0.8229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9049   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9049    0.4087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6138    0.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6138    1.6406    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.1933    0.8195    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.1933   -0.8238    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.5182   -0.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5182    0.4086    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3190    0.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7878    0.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2978   -0.6578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5105   -1.4515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3041   -1.6641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9295   -2.0325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5316    1.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9506    2.0325    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3253    1.6641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  6  7  1  0
  5  8  1  0
  4  9  1  0
  9 10  1  0
 11 10  1  0
 11 12  1  0
 12 13  2  0
 14 13  1  0
 10 14  2  0
 15 14  1  0
 15 16  2  0
 15 17  1  0
 12 18  1  0
 18 19  2  0
 18 20  1  0
M  CHG  2  15   1  17  -1
M  END

Alternative Forms

  1. Parent:

    ALA5268050

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.19Molecular Weight (Monoisotopic): 328.9680AlogP: 4.49#Rotatable Bonds: 4
Polar Surface Area: 60.21Molecular Species: ACIDHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: 3.56CX Basic pKa: CX LogP: 3.27CX LogD: 1.12
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.60Np Likeness Score: -0.76

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source