The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Macrolactin T ID: ALA5268131
Max Phase: Preclinical
Molecular Formula: C24H36O6
Molecular Weight: 420.55
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1CC[C@@H](O)/C=C/CC[C@H](O)C[C@@H](O)C/C=C\C=C\[C@@H](O)C/C=C/C=C\C(=O)O1
Standard InChI: InChI=1S/C24H36O6/c1-19-16-17-21(26)12-8-9-14-23(28)18-22(27)13-6-2-4-10-20(25)11-5-3-7-15-24(29)30-19/h2-8,10,12,15,19-23,25-28H,9,11,13-14,16-18H2,1H3/b5-3+,6-2-,10-4+,12-8+,15-7-/t19?,20-,21+,22+,23+/m1/s1
Standard InChI Key: XIAQCLJUACZXTD-HSVQPFKZSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
-2.1438 1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 1.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 1.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 2.0630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 1.6504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 0.8251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5734 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1441 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 -2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7146 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7146 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 -2.0631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -1.6505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1440 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 -0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5732 0.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5732 1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8584 2.0632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5734 -0.8252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8588 -2.0631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4293 2.8883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4293 -2.8883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
10 9 1 0
10 11 1 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
1 25 2 0
25 24 1 0
21 26 1 1
19 27 1 6
8 28 2 0
2 29 1 1
14 30 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 420.55Molecular Weight (Monoisotopic): 420.2512AlogP: 2.89#Rotatable Bonds: ┄Polar Surface Area: 107.22Molecular Species: NEUTRALHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.49CX LogD: 2.49Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.35Np Likeness Score: 2.33
References 1. El-Hossary EM, Cheng C, Hamed MM, Hamed MM, El-Sayed Hamed AN, Ohlsen K, Hentschel U, Abdelmohsen UR.. (2017) Antifungal potential of marine natural products., 126 [PMID:27936443 ] [10.1016/j.ejmech.2016.11.022 ]