rac-6-(1-Aminopentan-2-yl)-3-(pyridin-3-yl)-5,6-dihydrothieno[2,3-c]pyridin-7(4H)-one

ID: ALA5268272

Max Phase: Preclinical

Molecular Formula: C17H21N3OS

Molecular Weight: 315.44

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCC(CN)N1CCc2c(-c3cccnc3)csc2C1=O

Standard InChI:  InChI=1S/C17H21N3OS/c1-2-4-13(9-18)20-8-6-14-15(11-22-16(14)17(20)21)12-5-3-7-19-10-12/h3,5,7,10-11,13H,2,4,6,8-9,18H2,1H3

Standard InChI Key:  VSSUOCYBSRFPPI-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
   -0.2842   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2842   -0.9101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4277   -1.3185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1442   -0.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1397   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4277    0.3314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9195    0.1728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4059   -0.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9268   -1.1561    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1330    0.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5498    1.5532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7634    2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5605    2.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1420    1.9817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9332    1.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4281   -2.1435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9981   -1.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7132   -0.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9981   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7125   -2.5611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4270   -1.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1420   -0.9143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  5  4  2  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  4  9  1  0
 10  7  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
  3 16  2  0
  2 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
 21 18  1  0
 22 21  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5268272

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.44Molecular Weight (Monoisotopic): 315.1405AlogP: 2.94#Rotatable Bonds: 5
Polar Surface Area: 59.22Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.18CX LogP: 2.24CX LogD: 0.48
Aromatic Rings: 2Heavy Atoms: 22QED Weighted: 0.92Np Likeness Score: -0.75

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source