N-benzyl-N,N-dioctyl-N-methylammonium bromide

ID: ALA5268465

Max Phase: Preclinical

Molecular Formula: C24H44BrN

Molecular Weight: 346.62

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCC[N+](C)(CCCCCCCC)Cc1ccccc1.[Br-]

Standard InChI:  InChI=1S/C24H44N.BrH/c1-4-6-8-10-12-17-21-25(3,22-18-13-11-9-7-5-2)23-24-19-15-14-16-20-24;/h14-16,19-20H,4-13,17-18,21-23H2,1-3H3;1H/q+1;/p-1

Standard InChI Key:  DQKVMGIYKFEAKX-UHFFFAOYSA-M

Molfile:  

     RDKit          2D

 26 25  0  0  0  0  0  0  0  0999 V2000
   18.5643   -9.1253    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   15.1476   -9.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5383   -9.8991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3557   -9.9199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7834   -9.2211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3877   -8.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5716   -8.4825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6004   -9.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9920   -9.9577    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.8090   -9.9771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1979  -10.1504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9677  -10.9345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1736  -11.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9434  -11.9113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1493  -12.1040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9191  -12.8881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1249  -13.0808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8947  -13.8649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2007  -10.6943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0176  -10.7137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4093  -11.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.2263  -11.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6180  -12.1675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4349  -12.1869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.8266  -12.9041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4740  -10.6176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 10 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
  9 26  1  0
M  CHG  2   1  -1   9   1
M  END

Associated Targets(non-human)

Human alphaherpesvirus 3 (4092 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.62Molecular Weight (Monoisotopic): 346.3468AlogP: 7.35#Rotatable Bonds: 16
Polar Surface Area: 0.00Molecular Species: NEUTRALHBA: HBD:
#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.96CX LogD: 3.96
Aromatic Rings: 1Heavy Atoms: 25QED Weighted: 0.22Np Likeness Score: 0.21

References

1. Soukup O, Benkova M, Dolezal R, Sleha R, Malinak D, Salajkova S, Markova A, Hympanova M, Prchal L, Ryskova L, Hobzova L, Sepčić K, Gunde-Cimerman N, Korabecny J, Jun D, Bostikova V, Bostik P, Marek J..  (2020)  The wide-spectrum antimicrobial effect of novel N-alkyl monoquaternary ammonium salts and their mixtures; the QSAR study against bacteria.,  206  [PMID:32853858] [10.1016/j.ejmech.2020.112584]

Source