2-(cyclobutanecarbonyl)-3-(3,4-dihydroxy-5-nitrophenyl)-3-hydroxyacrylonitrile

ID: ALA5268705

Max Phase: Preclinical

Molecular Formula: C14H12N2O6

Molecular Weight: 304.26

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  N#C/C(C(=O)C1CCC1)=C(/O)c1cc(O)c(O)c([N+](=O)[O-])c1

Standard InChI:  InChI=1S/C14H12N2O6/c15-6-9(12(18)7-2-1-3-7)13(19)8-4-10(16(21)22)14(20)11(17)5-8/h4-5,7,17,19-20H,1-3H2/b13-9-

Standard InChI Key:  IVHXZEHQUUPOSL-LCYFTJDESA-N

Molfile:  

 
     RDKit          2D

 22 23  0  0  0  0  0  0  0  0999 V2000
   -2.2975    0.6181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5829    1.0304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8709    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8709   -0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5810   -0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2975   -0.2103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0121   -0.6230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5810   -1.4437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2957   -1.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8664   -1.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1563    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5583    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2730    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2730    1.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9876    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5583   -0.2066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5583   -1.0319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0121    1.0307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2013   -0.1788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0121    0.0384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7985    0.8358    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1563    1.8563    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  5  1  0
  8  9  1  0
  8 10  2  0
  3 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 16 12  1  0
 16 17  3  0
  1 18  1  0
 19 15  1  0
 19 20  1  0
 21 20  1  0
 15 21  1  0
 11 22  1  0
M  CHG  2   8   1   9  -1
M  END

Alternative Forms

  1. Parent:

    ALA5268705

    ---

Associated Targets(Human)

FTO Tchem Alpha-ketoglutarate-dependent dioxygenase FTO (473 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 304.26Molecular Weight (Monoisotopic): 304.0695AlogP: 2.17#Rotatable Bonds: 4
Polar Surface Area: 144.69Molecular Species: ACIDHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 4.69CX Basic pKa: CX LogP: 2.08CX LogD: -1.88
Aromatic Rings: 1Heavy Atoms: 22QED Weighted: 0.19Np Likeness Score: -0.73

References

1. Perry GS, Das M, Woon ECY..  (2021)  Inhibition of AlkB Nucleic Acid Demethylases: Promising New Epigenetic Targets.,  64  (23.0): [PMID:34792334] [10.1021/acs.jmedchem.1c01694]

Source