1-((1S,3aS,3bR,5aS,6aS,7aR,8aS,8bS,10aS)-8a,10a-dimethylhexadecahydro-1H-cyclopenta[7,8]phenanthro[2,3-b]oxiren-1-yl)-2-methoxyethan-1-one

ID: ALA5268883

Max Phase: Preclinical

Molecular Formula: C22H34O3

Molecular Weight: 346.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COCC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4C[C@@H]5O[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C22H34O3/c1-21-9-8-16-14(15(21)6-7-17(21)18(23)12-24-3)5-4-13-10-19-20(25-19)11-22(13,16)2/h13-17,19-20H,4-12H2,1-3H3/t13-,14-,15-,16-,17+,19-,20+,21-,22-/m0/s1

Standard InChI Key:  QXEZJPBANGODQJ-GQJKJRBPSA-N

Molfile:  

 
     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -2.8426   -0.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1282   -0.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4137   -0.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4137   -1.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1282   -2.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8426   -1.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6992   -0.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0152   -0.9294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0152   -1.7544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6992   -2.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6991    0.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0153    0.7206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7298    0.3081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7297   -0.5169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5338    0.5581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0045   -0.0953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5126   -0.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0152   -0.1041    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8200   -1.3372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8212    1.1283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7474    1.3553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1639    1.9388    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5445    1.5689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4136   -0.1041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6992   -1.3422    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4137   -2.5796    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5553   -1.3418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8426   -0.1041    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8426   -2.5796    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7582    2.3660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5553    2.5796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  7 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  8 14  1  0
 13 15  1  0
 15 16  1  0
 17 16  1  0
 14 17  1  0
  8 18  1  1
 14 19  1  6
 13 20  1  1
 15 21  1  1
 21 22  2  0
 21 23  1  0
  3 24  1  1
  7 25  1  6
  4 26  1  6
  6 27  1  0
  1 27  1  0
  1 28  1  1
  6 29  1  1
 23 30  1  0
 30 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5268883

    ---

Associated Targets(non-human)

Gabrp GABA-A receptor; anion channel (5731 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 346.51Molecular Weight (Monoisotopic): 346.2508AlogP: 4.24#Rotatable Bonds: 3
Polar Surface Area: 38.83Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.90CX LogD: 3.90
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.72Np Likeness Score: 2.07

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source