The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(6-(but-2-en-1-yl)-2-methyl-7-oxo-6,7-dihydro-1H-pyrrolo[2,3-c]pyridin-4-yl)-2-(morpholine-4-carbonyl)benzonitrile ID: ALA5268936
Max Phase: Preclinical
Molecular Formula: C24H24N4O3
Molecular Weight: 416.48
Associated Items:
Names and Identifiers Canonical SMILES: C/C=C/Cn1cc(-c2ccc(C(=O)N3CCOCC3)c(C#N)c2)c2cc(C)[nH]c2c1=O
Standard InChI: InChI=1S/C24H24N4O3/c1-3-4-7-28-15-21(20-12-16(2)26-22(20)24(28)30)17-5-6-19(18(13-17)14-25)23(29)27-8-10-31-11-9-27/h3-6,12-13,15,26H,7-11H2,1-2H3/b4-3+
Standard InChI Key: BQAKOVGAYWUDIT-ONEGZZNKSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-0.3340 2.4741 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3805 2.8864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0924 2.4745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0924 1.6493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3823 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3340 1.6456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3823 0.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0969 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0961 -0.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3813 -1.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3306 -0.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3353 -0.0020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3813 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0959 -2.4738 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3333 -2.4738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3333 -3.2990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0480 -3.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7626 -3.2990 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7626 -2.4738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0480 -2.0612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8754 1.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3674 2.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8966 2.7247 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3805 3.7116 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0487 2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7634 2.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4780 2.8867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1927 2.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1927 2.0710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8108 -1.2358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5255 -1.6485 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 5 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
10 13 1 0
13 14 2 0
13 15 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
15 20 1 0
4 21 1 0
21 22 2 0
23 22 1 0
3 23 1 0
2 24 2 0
1 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
22 29 1 0
9 30 1 0
30 31 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.48Molecular Weight (Monoisotopic): 416.1848AlogP: 3.23#Rotatable Bonds: 4Polar Surface Area: 91.12Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.85CX Basic pKa: ┄CX LogP: 2.23CX LogD: 2.23Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.66Np Likeness Score: -1.06
References 1. Crawford TD, Vartanian S, Côté A, Bellon S, Duplessis M, Flynn EM, Hewitt M, Huang HR, Kiefer JR, Murray J, Nasveschuk CG, Pardo E, Romero FA, Sandy P, Tang Y, Taylor AM, Tsui V, Wang J, Wang S, Zawadzke L, Albrecht BK, Magnuson SR, Cochran AG, Stokoe D.. (2017) Inhibition of bromodomain-containing protein 9 for the prevention of epigenetically-defined drug resistance., 27 (15): [PMID:28606761 ] [10.1016/j.bmcl.2017.05.063 ]