Epiccocarines B

ID: ALA5269058

Max Phase: Preclinical

Molecular Formula: C23H31NO5

Molecular Weight: 401.50

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC/C=C(\C)C[C@H](C)C[C@H](C)/C(O)=C1/C(=O)N[C@@H]([C@@H](O)c2ccc(O)cc2)C1=O

Standard InChI:  InChI=1S/C23H31NO5/c1-5-6-13(2)11-14(3)12-15(4)20(26)18-22(28)19(24-23(18)29)21(27)16-7-9-17(25)10-8-16/h6-10,14-15,19,21,25-27H,5,11-12H2,1-4H3,(H,24,29)/b13-6+,20-18-/t14-,15-,19-,21-/m0/s1

Standard InChI Key:  CRZCNQJDEBVYEU-DUQOIEBXSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   -4.6098   -0.4370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8952   -0.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1832   -0.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1832   -1.2618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8934   -1.6737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6098   -1.2655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3244   -1.6781    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4686   -0.0240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4686    0.8011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7539   -0.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0005   -0.1012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4484   -0.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8609   -1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6677   -1.2569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4485   -2.1427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3762   -0.7141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7885    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3762    0.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6132    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0256    0.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8503    0.7142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2626    1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0873    1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4997    2.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3244    2.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8503    2.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6132    1.4284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7885   -1.4283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7870    0.6954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4455   -0.8858    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  3  8  1  0
  8  9  1  6
 10  8  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 10  1  0
 13 15  2  0
 12 16  2  0
 16 17  1  0
 17 18  1  1
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 22 26  1  0
 20 27  1  1
 16 28  1  0
 11 29  2  0
 10 30  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5269058

    ---

Associated Targets(non-human)

Mycolicibacterium vaccae (371 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 401.50Molecular Weight (Monoisotopic): 401.2202AlogP: 3.71#Rotatable Bonds: 8
Polar Surface Area: 106.86Molecular Species: ACIDHBA: 5HBD: 4
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 4.93CX Basic pKa: CX LogP: 3.78CX LogD: 1.33
Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.23Np Likeness Score: 1.47

References

1. Mishra SK, Tripathi G, Kishore N, Singh RK, Singh A, Tiwari VK..  (2017)  Drug development against tuberculosis: Impact of alkaloids.,  137  [PMID:28628823] [10.1016/j.ejmech.2017.06.005]

Source