2-([1,2,4]triazolo[4,3-a]quinoxalin-4-ylthio)-N-(4-(N-(thiazol-2-yl)sulfamoyl)phenyl)acetamide

ID: ALA5269118

Max Phase: Preclinical

Molecular Formula: C20H15N7O3S3

Molecular Weight: 497.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2ccccc2n2cnnc12)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1

Standard InChI:  InChI=1S/C20H15N7O3S3/c28-17(11-32-19-18-25-22-12-27(18)16-4-2-1-3-15(16)24-19)23-13-5-7-14(8-6-13)33(29,30)26-20-21-9-10-31-20/h1-10,12H,11H2,(H,21,26)(H,23,28)

Standard InChI Key:  IQYIXSWPYQHESQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
    3.3118   -2.1601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9005   -1.4449    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4877   -2.1601    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6143   -1.0328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3282   -1.4449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0419   -1.0328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6599   -1.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3296   -2.3372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5064   -2.2450    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.1868   -1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4773   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7615   -1.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7615   -0.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4755    0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1868   -0.2084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0477    0.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6660   -0.2088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6660   -1.0330    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3798    0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0936   -0.2088    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8074    0.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5182   -0.2128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2352    0.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9444   -0.2105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6599    0.1970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6599    1.0245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9462    1.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2352    1.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5233    1.4353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3383    2.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5375    2.3372    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2055    1.5780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8074    1.0233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  6  5  2  0
  6  7  1  0
  7  8  2  0
  9  8  1  0
  5  9  1  0
 10  2  1  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 10 15  2  0
 16 13  1  0
 17 16  1  0
 17 18  2  0
 19 17  1  0
 20 19  1  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 23 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  2  0
 32 31  1  0
 33 32  2  0
 21 33  1  0
 33 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269118

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 497.59Molecular Weight (Monoisotopic): 497.0399AlogP: 3.27#Rotatable Bonds: 7
Polar Surface Area: 131.24Molecular Species: NEUTRALHBA: 10HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.77CX Basic pKa: 1.45CX LogP: 1.64CX LogD: 1.09
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -2.55

References

1. Aggarwal R, Sumran G..  (2020)  An insight on medicinal attributes of 1,2,4-triazoles.,  205  [PMID:32771798] [10.1016/j.ejmech.2020.112652]

Source