The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-fluorophenyl)-2-[3-[4-(trifluoromethyl)phenyl]phenyl]ethanehydroxamic acid ID: ALA5269131
Max Phase: Preclinical
Molecular Formula: C21H15F4NO2
Molecular Weight: 389.35
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NO)C(c1cccc(-c2ccc(C(F)(F)F)cc2)c1)c1ccccc1F
Standard InChI: InChI=1S/C21H15F4NO2/c22-18-7-2-1-6-17(18)19(20(27)26-28)15-5-3-4-14(12-15)13-8-10-16(11-9-13)21(23,24)25/h1-12,19,28H,(H,26,27)
Standard InChI Key: OCFQCWKQTHPOBR-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
1.7621 1.8757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7471 2.7005 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4841 1.4762 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1909 1.9016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0553 1.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 0.6253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3408 1.8627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3738 1.4504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0857 1.8623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0857 2.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3755 3.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3408 2.6913 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7922 0.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8063 -0.5967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0993 -1.0223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3802 -0.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3604 0.1980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3738 0.6253 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3342 -1.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3345 -1.8639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0472 -2.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7619 -1.8618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7635 -1.0409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0518 -0.6245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4764 -2.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4764 -3.0994 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.1909 -1.8618 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.1909 -2.6869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 1 0
3 4 1 0
1 5 1 0
5 6 1 0
5 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
7 12 1 0
13 6 2 0
14 13 1 0
15 14 2 0
16 15 1 0
17 16 2 0
6 17 1 0
8 18 1 0
16 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
24 23 2 0
19 24 1 0
22 25 1 0
25 26 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 389.35Molecular Weight (Monoisotopic): 389.1039AlogP: 5.15#Rotatable Bonds: 4Polar Surface Area: 49.33Molecular Species: NEUTRALHBA: 2HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.78CX Basic pKa: ┄CX LogP: 5.15CX LogD: 5.13Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.37Np Likeness Score: -0.90
References 1. Ahamad S, Bhat SA.. (2022) The Emerging Landscape of Small-Molecule Therapeutics for the Treatment of Huntington's Disease., 65 (24.0): [PMID:36490325 ] [10.1021/acs.jmedchem.2c00799 ]