methyl 3-[(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)carbamoyl]-7-methylpyrazolo[1,5-a]pyrimidine-6-carboxylate

ID: ALA5269229

Max Phase: Preclinical

Molecular Formula: C21H20N6O4

Molecular Weight: 420.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)c1cnc2c(C(=O)Nc3c(C)n(C)n(-c4ccccc4)c3=O)cnn2c1C

Standard InChI:  InChI=1S/C21H20N6O4/c1-12-15(21(30)31-4)10-22-18-16(11-23-26(12)18)19(28)24-17-13(2)25(3)27(20(17)29)14-8-6-5-7-9-14/h5-11H,1-4H3,(H,24,28)

Standard InChI Key:  ZAJUGDTZXLOCPH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    0.3569   -2.4799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -2.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7859   -2.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7859   -1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -1.2424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3569   -1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4471   -1.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9176   -2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4258   -2.7258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6604   -0.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4569   -0.3949    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6703    0.4018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4668    0.6155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5003    1.4565    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7474    1.7417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2303    1.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0499    0.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0773   -0.0250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -2.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2145   -2.4800    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5001   -3.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0714   -3.7171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2145    1.8688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5339    2.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4056    1.0939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1170    3.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9034    3.9157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1066    4.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5251    3.5501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7339    2.7527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2143   -4.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  9  8  2  0
  1  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 12 16  1  0
 13 17  1  0
 10 18  2  0
  3 19  1  0
 20 19  2  0
 19 21  1  0
  2 22  1  0
 14 23  1  0
 15 24  1  0
 16 25  2  0
 26 24  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 24 30  1  0
 21 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269229

    ---

Associated Targets(non-human)

CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 420.43Molecular Weight (Monoisotopic): 420.1546AlogP: 1.87#Rotatable Bonds: 4
Polar Surface Area: 112.52Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.95CX Basic pKa: 0.46CX LogP: 0.89CX LogD: 0.89
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.50Np Likeness Score: -1.85

References

1. Hammouda MM, Gaffer HE, Elattar KM..  (2022)  Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a]pyrimidine scaffold.,  13  (10.0): [PMID:36325400] [10.1039/d2md00192f]

Source