4-((5-(4-(benzyloxy)-3-methoxybenzylidene)-4-oxo-2-thioxothiazolidin-3-yl)methyl)benzoic acid

ID: ALA5269314

Max Phase: Preclinical

Molecular Formula: C26H21NO5S2

Molecular Weight: 491.59

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C2\SC(=S)N(Cc3ccc(C(=O)O)cc3)C2=O)ccc1OCc1ccccc1

Standard InChI:  InChI=1S/C26H21NO5S2/c1-31-22-13-19(9-12-21(22)32-16-18-5-3-2-4-6-18)14-23-24(28)27(26(33)34-23)15-17-7-10-20(11-8-17)25(29)30/h2-14H,15-16H2,1H3,(H,29,30)/b23-14-

Standard InChI Key:  YUVXDRGIWJVKCP-UCQKPKSFSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    5.1205    1.7774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7080    2.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1205    3.2063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8830    2.4918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4704    3.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6479    3.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2351    2.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4101    2.4929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9976    1.7784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1724    1.7784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2400    2.4929    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0735    0.9954    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.5941    0.5033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2478    0.9742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0447    0.7607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5941   -0.3216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1203   -0.7340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8378   -0.3198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5495   -0.7362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5479   -1.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8332   -1.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1205   -1.5591    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8332   -2.7947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6494    1.7754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4739    1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1187   -3.2073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2624   -1.9696    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768   -1.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6913   -1.9696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6916   -2.7947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4043   -3.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1189   -2.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1205   -1.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4089   -1.5553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  2  0
  4  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
  9 14  1  0
 14 13  1  0
 14 15  2  0
 13 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 22 17  2  0
 21 22  1  0
 21 23  1  0
  7 24  1  0
 25  4  1  0
 24 25  2  0
 23 26  1  0
 20 27  1  0
 27 28  1  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269314

    ---

Associated Targets(Human)

PTPN1 Tchem Protein-tyrosine phosphatase 1B (8528 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTPN2 Tchem T-cell protein-tyrosine phosphatase (1317 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.59Molecular Weight (Monoisotopic): 491.0861AlogP: 5.37#Rotatable Bonds: 8
Polar Surface Area: 76.07Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.07CX Basic pKa: CX LogP: 5.75CX LogD: 2.63
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.34Np Likeness Score: -1.13

References

1. Kerru N, Singh-Pillay A, Awolade P, Singh P..  (2018)  Current anti-diabetic agents and their molecular targets: A review.,  152  [PMID:29751237] [10.1016/j.ejmech.2018.04.061]

Source