(1R,2S,5S)-8'-(3-chloro-4-fluorobenzyl)-6'-hydroxy-1-(hydroxymethyl)-2'-methyl-9',10'-dihydro-2'H-spiro[bicyclo[3.1.0]hexane-2,3'-imidazo[5,1-a][2,6]naphthyridine]-1',5',7'(8'H)-trione

ID: ALA5269335

Max Phase: Preclinical

Molecular Formula: C24H23ClFN3O5

Molecular Weight: 487.92

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN1C(=O)c2c3c(c(O)c(=O)n2[C@]12CC[C@H]1C[C@@]12CO)C(=O)N(Cc1ccc(F)c(Cl)c1)CC3

Standard InChI:  InChI=1S/C24H23ClFN3O5/c1-27-21(33)18-14-5-7-28(10-12-2-3-16(26)15(25)8-12)20(32)17(14)19(31)22(34)29(18)24(27)6-4-13-9-23(13,24)11-30/h2-3,8,13,30-31H,4-7,9-11H2,1H3/t13-,23+,24-/m0/s1

Standard InChI Key:  CMKPKOVJKYIZNW-VIQBWKJQSA-N

Molfile:  

 
     RDKit          2D

 35 40  0  0  0  0  0  0  0  0999 V2000
   -4.5519    1.2664    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -3.8374    0.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1230    1.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4113    0.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4113    0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1212   -0.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8374    0.0256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6343   -0.1878    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6969    1.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9824    0.8543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2680    1.2668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4464    0.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4464    0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2680   -0.3831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9824    0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1640   -0.3846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8755    0.0319    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8737    0.8527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1590    1.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1590    2.0901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5881    1.2652    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2680    2.0918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4972   -0.5351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1712   -1.2710    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3472   -1.1838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7107    0.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5520    0.2616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8374   -0.4578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1896   -0.9752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9604   -1.2762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7639   -1.7672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5837   -1.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3130   -1.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0812   -2.0918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6343   -0.2443    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  2  7  1  0
  7  6  2  0
  7  8  1  0
  4  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 10 15  1  0
 13 16  2  0
 16 17  1  0
 17 18  1  0
 12 19  2  0
 18 19  1  0
 19 20  1  0
 18 21  2  0
 11 22  2  0
 17 23  1  0
 23 24  1  0
 25 24  1  0
 16 25  1  0
 23 26  1  6
 26 27  1  0
 27 28  1  0
 29 28  1  0
 23 29  1  0
 28 30  1  0
 29 30  1  0
 25 31  2  0
 24 32  1  0
 29 33  1  1
 33 34  1  0
 28 35  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5269335

    ---

Associated Targets(non-human)

Human immunodeficiency virus (3636 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.92Molecular Weight (Monoisotopic): 487.1310AlogP: 2.08#Rotatable Bonds: 3
Polar Surface Area: 103.08Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 8.08CX Basic pKa: 0.44CX LogP: 0.87CX LogD: 0.79
Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.69Np Likeness Score: -0.07

References

1. Wang Y, Gu SX, He Q, Fan R..  (2021)  Advances in the development of HIV integrase strand transfer inhibitors.,  225  [PMID:34425310] [10.1016/j.ejmech.2021.113787]

Source