The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-2-((S)-2-amino-3-phenylpropanamido)-2-((2S,4R,5R,6R)-6-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-4,5-dihydroxytetrahydro-2H-pyran-2-yl)acetic acid ID: ALA5269429
Max Phase: Preclinical
Molecular Formula: C20H24N4O8
Molecular Weight: 448.43
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](Cc1ccccc1)C(=O)N[C@H](C(=O)O)[C@@H]1C[C@@H](O)[C@@H](O)[C@H](n2ccc(=O)[nH]c2=O)O1
Standard InChI: InChI=1S/C20H24N4O8/c21-11(8-10-4-2-1-3-5-10)17(28)23-15(19(29)30)13-9-12(25)16(27)18(32-13)24-7-6-14(26)22-20(24)31/h1-7,11-13,15-16,18,25,27H,8-9,21H2,(H,23,28)(H,29,30)(H,22,26,31)/t11-,12+,13-,15-,16+,18+/m0/s1
Standard InChI Key: MZWYEBXQQMOLTC-QGJUDNFOSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
3.5727 -0.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5727 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2872 0.6189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2872 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0017 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5727 1.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8583 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8583 0.6189 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1437 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8583 -1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 -1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4291 0.6190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1310 -0.3769 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0000 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0000 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 1.8564 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7145 0.2064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4289 1.4439 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1435 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1435 -0.6185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8579 0.6189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5724 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5727 -0.6186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2854 -1.0292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0000 -0.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0017 0.2043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2900 0.6206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 0
8 7 1 0
8 2 1 0
9 8 1 1
10 9 1 0
10 11 1 6
12 10 1 0
12 13 1 6
14 12 1 0
15 14 1 0
15 16 1 0
9 16 1 0
15 17 1 6
15 18 1 0
18 19 1 6
19 20 1 0
19 21 2 0
18 22 1 0
22 23 1 0
23 24 2 0
23 25 1 0
25 26 1 1
25 27 1 0
27 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.43Molecular Weight (Monoisotopic): 448.1594AlogP: -2.31#Rotatable Bonds: 7Polar Surface Area: 196.97Molecular Species: ACIDHBA: 9HBD: 6#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.59CX Basic pKa: 8.00CX LogP: -3.92CX LogD: -4.01Aromatic Rings: 2Heavy Atoms: 32QED Weighted: 0.27Np Likeness Score: 0.71
References 1. Serpi M, Ferrari V, Pertusati F.. (2016) Nucleoside Derived Antibiotics to Fight Microbial Drug Resistance: New Utilities for an Established Class of Drugs?, 59 (23): [PMID:27607900 ] [10.1021/acs.jmedchem.6b00325 ]