7-amino-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-6-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide

ID: ALA5269443

Max Phase: Preclinical

Molecular Formula: C24H21N7O2

Molecular Weight: 439.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(NC(=O)c2cnn3c(N)c(-c4ccccc4)cnc23)c(=O)n(-c2ccccc2)n1C

Standard InChI:  InChI=1S/C24H21N7O2/c1-15-20(24(33)31(29(15)2)17-11-7-4-8-12-17)28-23(32)19-14-27-30-21(25)18(13-26-22(19)30)16-9-5-3-6-10-16/h3-14H,25H2,1-2H3,(H,28,32)

Standard InChI Key:  GJURBXLOTAOZCW-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -0.0503   -2.3508    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6641   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3785   -2.3508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3785   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6641   -1.1132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0503   -1.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8542   -1.2756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3250   -1.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8329   -2.5967    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0676   -0.4791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8643   -0.2658    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0776    0.5309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4947    1.1141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8860    1.8592    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6807    1.7299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8047    0.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6981    0.9007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4845    0.1040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0929   -2.7633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8072   -2.3510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5189   -2.7627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5189   -3.5877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8089   -3.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0929   -3.5914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6641   -3.5881    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5189    0.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2639    2.3131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4736    2.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8858    3.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4740    3.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6490    3.9995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2374    3.2897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6453    2.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  1  9  1  0
  9  8  2  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 12 16  2  0
 16 15  1  0
 13 17  2  0
 10 18  2  0
  3 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 19 24  1  0
 24 23  2  0
  2 25  1  0
 16 26  1  0
 15 27  1  0
 28 14  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 28 33  1  0
 33 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5269443

    ---

Associated Targets(non-human)

CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 439.48Molecular Weight (Monoisotopic): 439.1757AlogP: 3.03#Rotatable Bonds: 4
Polar Surface Area: 112.24Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.00CX Basic pKa: 0.63CX LogP: 1.60CX LogD: 1.59
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.70

References

1. Hammouda MM, Gaffer HE, Elattar KM..  (2022)  Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a]pyrimidine scaffold.,  13  (10.0): [PMID:36325400] [10.1039/d2md00192f]

Source