The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-amino-N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-6-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide ID: ALA5269443
Max Phase: Preclinical
Molecular Formula: C24H21N7O2
Molecular Weight: 439.48
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(NC(=O)c2cnn3c(N)c(-c4ccccc4)cnc23)c(=O)n(-c2ccccc2)n1C
Standard InChI: InChI=1S/C24H21N7O2/c1-15-20(24(33)31(29(15)2)17-11-7-4-8-12-17)28-23(32)19-14-27-30-21(25)18(13-26-22(19)30)16-9-5-3-6-10-16/h3-14H,25H2,1-2H3,(H,28,32)
Standard InChI Key: GJURBXLOTAOZCW-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-0.0503 -2.3508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6641 -2.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3785 -2.3508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3785 -1.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6641 -1.1132 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0503 -1.5257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8542 -1.2756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3250 -1.9293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8329 -2.5967 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0676 -0.4791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8643 -0.2658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0776 0.5309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4947 1.1141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8860 1.8592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6807 1.7299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8047 0.9104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6981 0.9007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4845 0.1040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0929 -2.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8072 -2.3510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5189 -2.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5189 -3.5877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8089 -3.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0929 -3.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6641 -3.5881 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5189 0.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2639 2.3131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4736 2.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8858 3.2878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4740 3.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6490 3.9995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2374 3.2897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6453 2.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 2 0
4 3 1 0
5 4 2 0
1 6 1 0
6 5 1 0
6 7 2 0
7 8 1 0
1 9 1 0
9 8 2 0
7 10 1 0
10 11 1 0
11 12 1 0
13 12 1 0
13 14 1 0
14 15 1 0
12 16 2 0
16 15 1 0
13 17 2 0
10 18 2 0
3 19 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
19 24 1 0
24 23 2 0
2 25 1 0
16 26 1 0
15 27 1 0
28 14 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
28 33 1 0
33 32 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.48Molecular Weight (Monoisotopic): 439.1757AlogP: 3.03#Rotatable Bonds: 4Polar Surface Area: 112.24Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.00CX Basic pKa: 0.63CX LogP: 1.60CX LogD: 1.59Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.45Np Likeness Score: -1.70
References 1. Hammouda MM, Gaffer HE, Elattar KM.. (2022) Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a ]pyrimidine scaffold., 13 (10.0): [PMID:36325400 ] [10.1039/d2md00192f ]