Cyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate

ID: ALA5269459

Max Phase: Preclinical

Molecular Formula: C20H33N3O5

Molecular Weight: 395.50

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O

Standard InChI:  InChI=1S/C20H33N3O5/c1-13(2)10-17(23-20(27)28-16-6-4-3-5-7-16)19(26)22-15(12-24)11-14-8-9-21-18(14)25/h12-17H,3-11H2,1-2H3,(H,21,25)(H,22,26)(H,23,27)/t14-,15-,17-/m0/s1

Standard InChI Key:  JAZGKZKQQSCVMM-ZOBUZTSGSA-N

Molfile:  

 
     RDKit          2D

 28 29  0  0  0  0  0  0  0  0999 V2000
    0.7754    0.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7754   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4898   -0.4963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.2047   -0.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2047    0.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9196    1.1545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6733    0.8189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2254    1.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8129    2.1466    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0058    1.9750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4221    2.5587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9196   -0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9196   -1.3207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0610   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0610   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7754   -1.7338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7754   -2.5587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4898   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6533   -0.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3677   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3677   -1.3213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0821   -0.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7966   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7966   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5110   -1.7337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2254   -1.3213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2254   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5110   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  1  1
  4  5  1  0
  6  5  1  1
  6  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
 10  6  1  0
 10 11  2  0
  4 12  1  0
 12 13  2  0
  2 14  1  0
 14 15  1  6
 15 16  1  0
 16 17  1  0
 16 18  1  0
 14 19  1  0
 19 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 23 28  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269459

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 395.50Molecular Weight (Monoisotopic): 395.2420AlogP: 1.67#Rotatable Bonds: 9
Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.79CX Basic pKa: CX LogP: 1.35CX LogD: 1.35
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: 0.64

References

1. Gao K, Wang R, Chen J, Tepe JJ, Huang F, Wei GW..  (2021)  Perspectives on SARS-CoV-2 Main Protease Inhibitors.,  64  (23.0): [PMID:34798775] [10.1021/acs.jmedchem.1c00409]

Source