The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate ID: ALA5269459
Max Phase: Preclinical
Molecular Formula: C20H33N3O5
Molecular Weight: 395.50
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)OC1CCCCC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O
Standard InChI: InChI=1S/C20H33N3O5/c1-13(2)10-17(23-20(27)28-16-6-4-3-5-7-16)19(26)22-15(12-24)11-14-8-9-21-18(14)25/h12-17H,3-11H2,1-2H3,(H,21,25)(H,22,26)(H,23,27)/t14-,15-,17-/m0/s1
Standard InChI Key: JAZGKZKQQSCVMM-ZOBUZTSGSA-N
Molfile:
RDKit 2D
28 29 0 0 0 0 0 0 0 0999 V2000
0.7754 0.7410 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7754 -0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4898 -0.4963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2047 -0.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2047 0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9196 1.1545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6733 0.8189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2254 1.4321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8129 2.1466 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0058 1.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4221 2.5587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9196 -0.4963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9196 -1.3207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 -1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7754 -1.7338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7754 -2.5587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4898 -1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6533 -0.0839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3677 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3677 -1.3213 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0821 -0.0839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7966 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7966 -1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5110 -1.7337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2254 -1.3213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2254 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5110 -0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 1
4 5 1 0
6 5 1 1
6 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
10 6 1 0
10 11 2 0
4 12 1 0
12 13 2 0
2 14 1 0
14 15 1 6
15 16 1 0
16 17 1 0
16 18 1 0
14 19 1 0
19 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
24 23 1 0
25 24 1 0
26 25 1 0
27 26 1 0
28 27 1 0
23 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 395.50Molecular Weight (Monoisotopic): 395.2420AlogP: 1.67#Rotatable Bonds: 9Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.79CX Basic pKa: ┄CX LogP: 1.35CX LogD: 1.35Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.51Np Likeness Score: 0.64