The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4,4',4''-(Benzene-1,3,5-triyltris(oxy))tribenzimidamide ID: ALA5269464
Max Phase: Preclinical
Molecular Formula: C27H24N6O3
Molecular Weight: 480.53
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)c1ccc(Oc2cc(Oc3ccc(C(=N)N)cc3)cc(Oc3ccc(C(=N)N)cc3)c2)cc1
Standard InChI: InChI=1S/C27H24N6O3/c28-25(29)16-1-7-19(8-2-16)34-22-13-23(35-20-9-3-17(4-10-20)26(30)31)15-24(14-22)36-21-11-5-18(6-12-21)27(32)33/h1-15H,(H3,28,29)(H3,30,31)(H3,32,33)
Standard InChI Key: FJZLYGDCIBSPGQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-0.7126 2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0019 2.4736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7137 2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7137 1.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0036 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7126 1.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0036 -0.0003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7183 -0.4129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4331 -0.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1452 -0.4126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1452 -1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4349 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7183 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8598 -1.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5745 -1.2380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8598 -2.4757 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4284 2.4743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1430 2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8578 2.4741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5699 2.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5699 1.2367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8596 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1430 1.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2846 0.8241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9992 1.2367 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4273 2.4739 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1419 2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1421 1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8551 0.8254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5699 1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5715 2.0592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8596 2.4757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2845 0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2845 0.0003 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2846 -0.0010 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9992 1.2381 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
8 13 1 0
11 14 1 0
14 15 2 0
14 16 1 0
3 17 1 0
17 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
21 24 1 0
24 25 1 0
1 26 1 0
26 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
30 33 1 0
33 34 1 0
24 35 2 0
33 36 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 480.53Molecular Weight (Monoisotopic): 480.1910AlogP: 4.92#Rotatable Bonds: 9Polar Surface Area: 177.30Molecular Species: BASEHBA: 6HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 9#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 12.15CX LogP: 3.24CX LogD: -3.99Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.15Np Likeness Score: -0.06
References 1. Hammerschmidt SJ, Maus H, Weldert AC, Gütschow M, Kersten C.. (2023) Improving binding entropy by higher ligand symmetry? - A case study with human matriptase., 14 (5): [PMID:37252099 ] [10.1039/d3md00125c ]